EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H9NO3 |
| Net Charge | 0 |
| Average Mass | 143.142 |
| Monoisotopic Mass | 143.05824 |
| SMILES | C=CCC(=O)NCC(=O)O |
| InChI | InChI=1S/C6H9NO3/c1-2-3-5(8)7-4-6(9)10/h2H,1,3-4H2,(H,7,8)(H,9,10) |
| InChIKey | UKISAGFGRDHYFO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-vinylacetylglycine (CHEBI:74435) has functional parent but-3-enoic acid (CHEBI:35897) |
| N-vinylacetylglycine (CHEBI:74435) has functional parent glycine (CHEBI:15428) |
| N-vinylacetylglycine (CHEBI:74435) has role metabolite (CHEBI:25212) |
| N-vinylacetylglycine (CHEBI:74435) is a N-acylglycine (CHEBI:16180) |
| IUPAC Names |
|---|
| (but-3-enoylamino)acetic acid |
| N-but-3-enoylglycine |
| Synonym | Source |
|---|---|
| 2-(but-3-enamido)acetic acid | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0000894 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:20234615 | Reaxys |