EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:35349 - 7β-hydroxy steroid
| Formula | C19H31OR |
| Net Charge | 0 |
| Average Mass (excl. R groups) | 275.450 |
| Monoisotopic Mass (excl. R groups) | 275.23749 |
| SMILES | *C1CCC2C3C(CCC12C)C1(C)CCCCC1C[C@@H]3O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7β-hydroxy steroid (CHEBI:35349) is a 7-hydroxy steroid (CHEBI:36844) |
| Incoming Relation(s) |
| 3a,7b,21-trihydroxy-5b-cholanoic acid (CHEBI:145759) is a 7β-hydroxy steroid (CHEBI:35349) |
| 3α,7β-dihydroxy-12-oxo-5β-cholanic acid (CHEBI:138401) is a 7β-hydroxy steroid (CHEBI:35349) |
| 3α,7β-dihydroxy-5β-cholest-24-en-26-oic acid (CHEBI:72727) is a 7β-hydroxy steroid (CHEBI:35349) |
| 7β-hydroxy-3-oxo-5α-cholan-24-oic acid (CHEBI:145760) is a 7β-hydroxy steroid (CHEBI:35349) |
| 7β-hydroxy-3,12-dioxo-5β-cholanic acid (CHEBI:138399) is a 7β-hydroxy steroid (CHEBI:35349) |
| 7β-hydroxycholesterol (CHEBI:42989) is a 7β-hydroxy steroid (CHEBI:35349) |
| 7β-hydroxydehydroepiandrosterone (CHEBI:183368) is a 7β-hydroxy steroid (CHEBI:35349) |
| 7β-hydroxyepiandrosterone (CHEBI:183809) is a 7β-hydroxy steroid (CHEBI:35349) |
| 7β-hydroxypregnenolone (CHEBI:183806) is a 7β-hydroxy steroid (CHEBI:35349) |
| 7β,25-dihydroxycholesterol (CHEBI:180498) is a 7β-hydroxy steroid (CHEBI:35349) |
| sinularia glycoside (CHEBI:66487) is a 7β-hydroxy steroid (CHEBI:35349) |
| tauro-β-muricholic acid (CHEBI:133057) is a 7β-hydroxy steroid (CHEBI:35349) |
| ursocholic acid (CHEBI:81240) is a 7β-hydroxy steroid (CHEBI:35349) |
| ursodeoxycholic acid 3-sulfate (CHEBI:89499) is a 7β-hydroxy steroid (CHEBI:35349) |
| β-muricholic acid (CHEBI:81298) is a 7β-hydroxy steroid (CHEBI:35349) |
| Synonyms | Source |
|---|---|
| 7beta-Hydroxysteroid | KEGG COMPOUND |
| 7β-hydroxy steroids | ChEBI |
| UniProt Name | Source |
|---|---|
| a 7β-hydroxysteroid | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 7-Beta-Hydroxysteroids | MetaCyc |
| C02956 | KEGG COMPOUND |