EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H30O3 |
| Net Charge | 0 |
| Average Mass | 306.446 |
| Monoisotopic Mass | 306.21949 |
| SMILES | [H][C@]12C[C@@H](O)CC[C@]1(C)[C@@]1([H])CC[C@]3(C)C(=O)CC[C@@]3([H])[C@]1([H])[C@@H](O)C2 |
| InChI | InChI=1S/C19H30O3/c1-18-7-5-12(20)9-11(18)10-15(21)17-13-3-4-16(22)19(13,2)8-6-14(17)18/h11-15,17,20-21H,3-10H2,1-2H3/t11-,12+,13+,14+,15+,17+,18+,19+/m1/s1 |
| InChIKey | VFPMCLQMAUVEHD-UCPSWNCLSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood plasma (BTO:0000131) | PubMed (30484677) |
| Roles Classification |
|---|
| Biological Roles: | estrogen receptor antagonist An antagonist at the estrogen receptor. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| Applications: | estrogen receptor antagonist An antagonist at the estrogen receptor. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7β-hydroxyepiandrosterone (CHEBI:183809) has functional parent epiandrosterone (CHEBI:541975) |
| 7β-hydroxyepiandrosterone (CHEBI:183809) has role androgen (CHEBI:50113) |
| 7β-hydroxyepiandrosterone (CHEBI:183809) has role estrogen receptor antagonist (CHEBI:50792) |
| 7β-hydroxyepiandrosterone (CHEBI:183809) has role human metabolite (CHEBI:77746) |
| 7β-hydroxyepiandrosterone (CHEBI:183809) has role neuroprotective agent (CHEBI:63726) |
| 7β-hydroxyepiandrosterone (CHEBI:183809) is a 17-oxo steroid (CHEBI:19168) |
| 7β-hydroxyepiandrosterone (CHEBI:183809) is a 3β-hydroxy steroid (CHEBI:36836) |
| 7β-hydroxyepiandrosterone (CHEBI:183809) is a 7β-hydroxy steroid (CHEBI:35349) |
| 7β-hydroxyepiandrosterone (CHEBI:183809) is a androstanoid (CHEBI:50402) |
| IUPAC Name |
|---|
| 3β,7β-dihydroxy-5α-androstan-17-one |
| Synonyms | Source |
|---|---|
| (3β,5α,7β)-3,7-dihydroxyandrostan-17-one | ChemIDplus |
| 7-beta-hydroxyepiandrosterone | ChemIDplus |
| 7β-hydroxy-epiandrosterone | ChEBI |
| 7β-OH-EPIA | ChemIDplus |
| HF-0220 | ChemIDplus |
| HF0220 | DrugBank |
| UniProt Name | Source |
|---|---|
| 3β,7β-dihydroxy-5α-androstan-17-one | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 7%CE%B2-Hydroxyepiandrosterone | Wikipedia |
| 8011902 | ChemSpider |
| DB06622 | DrugBank |
| HMDB0259631 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:25848-69-5 | ChemIDplus |
| Citations |
|---|