EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H30O3 |
| Net Charge | 0 |
| Average Mass | 306.446 |
| Monoisotopic Mass | 306.21949 |
| SMILES | [H][C@]12C[C@@H](O)CC[C@]1(C)[C@@]1([H])CC[C@]3(C)C(=O)CC[C@@]3([H])[C@]1([H])[C@@H](O)C2 |
| InChI | InChI=1S/C19H30O3/c1-18-7-5-12(20)9-11(18)10-15(21)17-13-3-4-16(22)19(13,2)8-6-14(17)18/h11-15,17,20-21H,3-10H2,1-2H3/t11-,12+,13+,14+,15+,17+,18+,19+/m1/s1 |
| InChIKey | VFPMCLQMAUVEHD-UCPSWNCLSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood plasma (BTO:0000131) | PubMed (30484677) |
| Roles Classification |
|---|
| Biological Roles: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. estrogen receptor antagonist An antagonist at the estrogen receptor. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| Applications: | neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. estrogen receptor antagonist An antagonist at the estrogen receptor. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7β-hydroxyepiandrosterone (CHEBI:183809) has functional parent epiandrosterone (CHEBI:541975) |
| 7β-hydroxyepiandrosterone (CHEBI:183809) has role androgen (CHEBI:50113) |
| 7β-hydroxyepiandrosterone (CHEBI:183809) has role estrogen receptor antagonist (CHEBI:50792) |
| 7β-hydroxyepiandrosterone (CHEBI:183809) has role human metabolite (CHEBI:77746) |
| 7β-hydroxyepiandrosterone (CHEBI:183809) has role neuroprotective agent (CHEBI:63726) |
| 7β-hydroxyepiandrosterone (CHEBI:183809) is a 17-oxo steroid (CHEBI:19168) |
| 7β-hydroxyepiandrosterone (CHEBI:183809) is a 3β-hydroxy steroid (CHEBI:36836) |
| 7β-hydroxyepiandrosterone (CHEBI:183809) is a 7β-hydroxy steroid (CHEBI:35349) |
| 7β-hydroxyepiandrosterone (CHEBI:183809) is a androstanoid (CHEBI:50402) |
| IUPAC Name |
|---|
| 3β,7β-dihydroxy-5α-androstan-17-one |
| Synonyms | Source |
|---|---|
| (3β,5α,7β)-3,7-dihydroxyandrostan-17-one | ChemIDplus |
| 7-beta-hydroxyepiandrosterone | ChemIDplus |
| 7β-hydroxy-epiandrosterone | ChEBI |
| 7β-OH-EPIA | ChemIDplus |
| HF-0220 | ChemIDplus |
| HF0220 | DrugBank |
| UniProt Name | Source |
|---|---|
| 3β,7β-dihydroxy-5α-androstan-17-one | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 7%CE%B2-Hydroxyepiandrosterone | Wikipedia |
| 8011902 | ChemSpider |
| DB06622 | DrugBank |
| HMDB0259631 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:25848-69-5 | ChemIDplus |
| Citations |
|---|