EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H36O5 |
| Net Charge | 0 |
| Average Mass | 404.547 |
| Monoisotopic Mass | 404.25627 |
| SMILES | [H][C@@]12CC(=O)CC[C@]1(C)[C@@]1([H])CC(=O)[C@@]3(C)[C@@]([H])(CC[C@]3([H])[C@H](C)CCC(=O)O)[C@]1([H])[C@@H](O)C2 |
| InChI | InChI=1S/C24H36O5/c1-13(4-7-21(28)29)16-5-6-17-22-18(12-20(27)24(16,17)3)23(2)9-8-15(25)10-14(23)11-19(22)26/h13-14,16-19,22,26H,4-12H2,1-3H3,(H,28,29)/t13-,14+,16-,17+,18+,19+,22+,23+,24-/m1/s1 |
| InChIKey | LOGQGKJLNOCUQM-XDFFKFLRSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7β-hydroxy-3,12-dioxo-5β-cholanic acid (CHEBI:138399) is a 12-oxo steroid (CHEBI:48070) |
| 7β-hydroxy-3,12-dioxo-5β-cholanic acid (CHEBI:138399) is a 3-oxo-5β-steroid (CHEBI:1624) |
| 7β-hydroxy-3,12-dioxo-5β-cholanic acid (CHEBI:138399) is a 7β-hydroxy steroid (CHEBI:35349) |
| 7β-hydroxy-3,12-dioxo-5β-cholanic acid (CHEBI:138399) is a oxo-5β-cholanic acid (CHEBI:25753) |
| 7β-hydroxy-3,12-dioxo-5β-cholanic acid (CHEBI:138399) is conjugate acid of 7β-hydroxy-3,12-dioxo-5β-cholanate (CHEBI:137882) |
| Incoming Relation(s) |
| 7β-hydroxy-3,12-dioxo-5β-cholanate (CHEBI:137882) is conjugate base of 7β-hydroxy-3,12-dioxo-5β-cholanic acid (CHEBI:138399) |
| IUPAC Name |
|---|
| 7β-hydroxy-3,12-dioxo-5β-cholan-24-oic acid |
| Synonym | Source |
|---|---|
| (5β,7β)-7-hydroxy-3,12-dioxocholan-24-oic acid | IUPAC |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5773040 | Reaxys |
| Citations |
|---|