EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H28O3 |
| Net Charge | 0 |
| Average Mass | 304.430 |
| Monoisotopic Mass | 304.20384 |
| SMILES | [H][C@]12CC[C@]3(C)C(=O)CC[C@@]3([H])[C@]1([H])[C@@H](O)C=C1C[C@@H](O)CC[C@@]12C |
| InChI | InChI=1S/C19H28O3/c1-18-7-5-12(20)9-11(18)10-15(21)17-13-3-4-16(22)19(13,2)8-6-14(17)18/h10,12-15,17,20-21H,3-9H2,1-2H3/t12-,13-,14-,15-,17-,18-,19-/m0/s1 |
| InChIKey | OLPSAOWBSPXZEA-GCNMQWDSSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bombus terrestris (ncbitaxon:30195) | |||
| brain (BTO:0000142) | MetaboLights (MTBLS3637) | ||
| hemolymph (BTO:0000572) | MetaboLights (MTBLS3637) | ||
| hindgut (BTO:0000510) | MetaboLights (MTBLS3637) | ||
| Homo sapiens (ncbitaxon:9606) | blood serum (BTO:0000133) | PubMed (10030693) |
| Roles Classification |
|---|
| Biological Roles: | estrogen A hormone that stimulates or controls the development and maintenance of female sex characteristics in mammals by binding to oestrogen receptors. The oestrogens are named for their importance in the oestrous cycle. The oestrogens that occur naturally in the body, notably estrone, estradiol, estriol, and estetrol are steroids. Other compounds with oestrogenic activity are produced by plants (phytoestrogens) and fungi (mycoestrogens); synthetic compounds with oestrogenic activity are known as xenoestrogens. human blood serum metabolite Any metabolite (endogenous or exogenous) found in human blood serum samples. animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7β-hydroxydehydroepiandrosterone (CHEBI:183368) has functional parent dehydroepiandrosterone (CHEBI:28689) |
| 7β-hydroxydehydroepiandrosterone (CHEBI:183368) has role animal metabolite (CHEBI:75767) |
| 7β-hydroxydehydroepiandrosterone (CHEBI:183368) has role estrogen (CHEBI:50114) |
| 7β-hydroxydehydroepiandrosterone (CHEBI:183368) has role human blood serum metabolite (CHEBI:85234) |
| 7β-hydroxydehydroepiandrosterone (CHEBI:183368) is a 17-oxo steroid (CHEBI:19168) |
| 7β-hydroxydehydroepiandrosterone (CHEBI:183368) is a 3β-hydroxy-Δ5-steroid (CHEBI:1722) |
| 7β-hydroxydehydroepiandrosterone (CHEBI:183368) is a 7β-hydroxy steroid (CHEBI:35349) |
| 7β-hydroxydehydroepiandrosterone (CHEBI:183368) is a androstanoid (CHEBI:50402) |
| IUPAC Name |
|---|
| 3β,7β-dihydroxyandrost-5-en-17-one |
| Synonyms | Source |
|---|---|
| (3aS,3bR,4R,7S,9aR,9bS,11aS)-4,7-dihydroxy-9a,11a-dimethyl-2,3,3a,3b,4,6,7,8,9,9a,9b,10,11,11a-tetradecahydro-1H-cyclopenta[a]phenanthren-1-one | IUPAC |
| (3β,7β)-3,7-dihydroxyandrost-5-en-17-one | ChemIDplus |
| androst-5-ene-3β,7β-diol-17-one | ChemIDplus |
| 3β,7β-dihydroxy-5-androsten-17-one | ChEBI |
| 3β,7β-dihydroxy-5-androstene-17-one | ChEBI |
| 7-β-OH-DHEA | ChemIDplus |
| UniProt Name | Source |
|---|---|
| 3β,7β-dihydroxyandrost-5-en-17-one | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 7993704 | ChemSpider |
| HMDB0004624 | HMDB |
| LMST02020106 | LIPID MAPS |
| FDB023384 | FooDB |
| 7%CE%B2-Hydroxy-DHEA | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:2487-48-1 | ChemIDplus |
| Citations |
|---|