EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H10 |
| Net Charge | 0 |
| Average Mass | 178.234 |
| Monoisotopic Mass | 178.07825 |
| SMILES | c1ccc2cc3ccccc3cc2c1 |
| InChI | InChI=1S/C14H10/c1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1/h1-10H |
| InChIKey | MWPLVEDNUUSJAV-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. |
| Application: | endocrine disruptor Any compound that can disrupt the functions of the endocrine (hormone) system |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| anthracene (CHEBI:35298) is a ortho-fused tricyclic hydrocarbon (CHEBI:37089) |
| anthracene (CHEBI:35298) is a acene (CHEBI:35297) |
| anthracene (CHEBI:35298) is a anthracenes (CHEBI:46955) |
| Incoming Relation(s) |
| anthraflavic acid (CHEBI:34250) has parent hydride anthracene (CHEBI:35298) |
| anthrarufin (CHEBI:37501) has parent hydride anthracene (CHEBI:35298) |
| anthracen-1-yl group (CHEBI:48287) is substituent group from anthracene (CHEBI:35298) |
| anthracen-2-yl group (CHEBI:48371) is substituent group from anthracene (CHEBI:35298) |
| IUPAC Name |
|---|
| anthracene |
| Synonyms | Source |
|---|---|
| Anthracene | KEGG COMPOUND |
| ANTHRACENE | PDBeChem |
| Anthrazen | ChEBI |
| Citations |
|---|