EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H18 |
| Net Charge | 0 |
| Average Mass | 378.474 |
| Monoisotopic Mass | 378.14085 |
| SMILES | c1ccc2cc3cc4cc5cc6cc7ccccc7cc6cc5cc4cc3cc2c1 |
| InChI | InChI=1S/C30H18/c1-2-6-20-10-24-14-28-18-30-16-26-12-22-8-4-3-7-21(22)11-25(26)15-29(30)17-27(28)13-23(24)9-19(20)5-1/h1-18H |
| InChIKey | KDEZIUOWTXJEJK-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. |
| Application: | endocrine disruptor Any compound that can disrupt the functions of the endocrine (hormone) system |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| heptacene (CHEBI:33156) is a acene (CHEBI:35297) |
| heptacene (CHEBI:33156) is a heptacenes (CHEBI:51273) |
| Synonym | Source |
|---|---|
| heptacene | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| Heptacene | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2295681 | Reaxys |