EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:16782 - (S)-2-hydroxyglutarate(2−)
| Formula | C5H6O5 |
| Net Charge | -2 |
| Average Mass | 146.098 |
| Monoisotopic Mass | 146.02262 |
| SMILES | O=C([O-])CC[C@H](O)C(=O)[O-] |
| InChI | InChI=1S/C5H8O5/c6-3(5(9)10)1-2-4(7)8/h3,6H,1-2H2,(H,7,8)(H,9,10)/p-2/t3-/m0/s1 |
| InChIKey | HWXBTNAVRSUOJR-VKHMYHEASA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-2-hydroxyglutarate(2−) (CHEBI:16782) is a 2-hydroxyglutarate(2−) (CHEBI:11596) |
| (S)-2-hydroxyglutarate(2−) (CHEBI:16782) is conjugate base of (S)-2-hydroxyglutaric acid (CHEBI:32797) |
| (S)-2-hydroxyglutarate(2−) (CHEBI:16782) is enantiomer of (R)-2-hydroxyglutarate(2−) (CHEBI:15801) |
| Incoming Relation(s) |
| (S)-α-hydroxyglutarate-γ-lactone (CHEBI:73673) has functional parent (S)-2-hydroxyglutarate(2−) (CHEBI:16782) |
| (S)-2-hydroxyglutaric acid (CHEBI:32797) is conjugate acid of (S)-2-hydroxyglutarate(2−) (CHEBI:16782) |
| (R)-2-hydroxyglutarate(2−) (CHEBI:15801) is enantiomer of (S)-2-hydroxyglutarate(2−) (CHEBI:16782) |
| IUPAC Name |
|---|
| (2S)-2-hydroxypentanedioate |
| UniProt Name | Source |
|---|---|
| (S)-2-hydroxyglutarate | UniProt |