EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:32752 - selenocysteinate(1−)
| Formula | C3H6NO2Se |
| Net Charge | -1 |
| Average Mass | 167.046 |
| Monoisotopic Mass | 167.95692 |
| SMILES | NC(C[SeH])C(=O)[O-] |
| InChI | InChI=1S/C3H7NO2Se/c4-2(1-7)3(5)6/h2,7H,1,4H2,(H,5,6)/p-1 |
| InChIKey | ZKZBPNGNEQAJSX-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| selenocysteinate(1−) (CHEBI:32752) is a α-amino-acid anion (CHEBI:33558) |
| selenocysteinate(1−) (CHEBI:32752) is conjugate acid of selenocysteinate(2−) (CHEBI:32753) |
| selenocysteinate(1−) (CHEBI:32752) is conjugate base of selenocysteine (CHEBI:9093) |
| Incoming Relation(s) |
| D-selenocysteinate(1−) (CHEBI:32747) is a selenocysteinate(1−) (CHEBI:32752) |
| L-selenocysteinate(1−) (CHEBI:32742) is a selenocysteinate(1−) (CHEBI:32752) |
| selenocysteine (CHEBI:9093) is conjugate acid of selenocysteinate(1−) (CHEBI:32752) |
| selenocysteinate(2−) (CHEBI:32753) is conjugate base of selenocysteinate(1−) (CHEBI:32752) |
| IUPAC Name |
|---|
| 2-amino-3-selanylpropanoate |
| Synonyms | Source |
|---|---|
| hydrogen selenocysteinate | JCBN |
| selenocysteinate(1−) | JCBN |
| selenocysteine monoanion | JCBN |