EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H5NO2Se |
| Net Charge | -2 |
| Average Mass | 166.038 |
| Monoisotopic Mass | 166.94965 |
| SMILES | NC(C[Se-])C(=O)[O-] |
| InChI | InChI=1S/C3H7NO2Se/c4-2(1-7)3(5)6/h2,7H,1,4H2,(H,5,6)/p-2 |
| InChIKey | ZKZBPNGNEQAJSX-UHFFFAOYSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| selenocysteinate(2−) (CHEBI:32753) is a α-amino-acid anion (CHEBI:33558) |
| selenocysteinate(2−) (CHEBI:32753) is conjugate base of selenocysteinate(1−) (CHEBI:32752) |
| Incoming Relation(s) |
| D-selenocysteinate(2−) (CHEBI:32750) is a selenocysteinate(2−) (CHEBI:32753) |
| L-selenocysteinate(2−) (CHEBI:32743) is a selenocysteinate(2−) (CHEBI:32753) |
| selenocysteinate(1−) (CHEBI:32752) is conjugate acid of selenocysteinate(2−) (CHEBI:32753) |
| IUPAC Name |
|---|
| 2-amino-3-selenidopropanoate |
| Synonyms | Source |
|---|---|
| selenocysteinate | JCBN |
| selenocysteinate(2−) | JCBN |
| selenocysteine dianion | JCBN |