EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H5NO2S |
| Net Charge | -2 |
| Average Mass | 119.145 |
| Monoisotopic Mass | 119.00520 |
| SMILES | NC(C[S-])C(=O)[O-] |
| InChI | InChI=1S/C3H7NO2S/c4-2(1-7)3(5)6/h2,7H,1,4H2,(H,5,6)/p-2 |
| InChIKey | XUJNEKJLAYXESH-UHFFFAOYSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cysteinate(2−) (CHEBI:32457) is a α-amino-acid anion (CHEBI:33558) |
| cysteinate(2−) (CHEBI:32457) is conjugate base of cysteinate(1−) (CHEBI:32456) |
| Incoming Relation(s) |
| D-cysteinate(2−) (CHEBI:32450) is a cysteinate(2−) (CHEBI:32457) |
| L-cysteinate(2−) (CHEBI:32443) is a cysteinate(2−) (CHEBI:32457) |
| cysteinate(1−) (CHEBI:32456) is conjugate acid of cysteinate(2−) (CHEBI:32457) |
| cysteinate residue (CHEBI:32461) is substituent group from cysteinate(2−) (CHEBI:32457) |
| IUPAC Name |
|---|
| cysteinate |
| Synonyms | Source |
|---|---|
| 2-amino-3-sulfidopropanoate | IUPAC |
| cysteinate(2−) | JCBN |
| cysteine dianion | JCBN |
| Registry Numbers | Sources |
|---|---|
| Gmelin:49990 | Gmelin |