EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:32425 - (11Z)-icos-11-enoic acid
| Formula | C20H38O2 |
| Net Charge | 0 |
| Average Mass | 310.522 |
| Monoisotopic Mass | 310.28718 |
| SMILES | CCCCCCCC/C=C\CCCCCCCCCC(=O)O |
| InChI | InChI=1S/C20H38O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h9-10H,2-8,11-19H2,1H3,(H,21,22)/b10-9- |
| InChIKey | BITHHVVYSMSWAG-KTKRTIGZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Calophyllum calaba (ncbitaxon:883767) | - | PubMed (16045947) | |
| Calophyllum inophyllum (ncbitaxon:158927) | - | PubMed (16045947) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (11Z)-icos-11-enoic acid (CHEBI:32425) has role human metabolite (CHEBI:77746) |
| (11Z)-icos-11-enoic acid (CHEBI:32425) has role plant metabolite (CHEBI:76924) |
| (11Z)-icos-11-enoic acid (CHEBI:32425) is a icosenoic acid (CHEBI:23902) |
| (11Z)-icos-11-enoic acid (CHEBI:32425) is conjugate acid of gondoate (CHEBI:32426) |
| Incoming Relation(s) |
| N-(11Z-icosenoyl)-sphingosine-1-phosphocholine (CHEBI:90494) has functional parent (11Z)-icos-11-enoic acid (CHEBI:32425) |
| N-(11Z)-icosenoylphytosphingosine (CHEBI:85286) has functional parent (11Z)-icos-11-enoic acid (CHEBI:32425) |
| N-(11Z)-icosenoylsphinganine (CHEBI:85285) has functional parent (11Z)-icos-11-enoic acid (CHEBI:32425) |
| N-(11Z)-icosenoylsphingosine (CHEBI:85284) has functional parent (11Z)-icos-11-enoic acid (CHEBI:32425) |
| N-gondoylethanolamine (CHEBI:73725) has functional parent (11Z)-icos-11-enoic acid (CHEBI:32425) |
| 1-[(8Z,11Z,14Z,17Z)-icosatetraenoyl]-2-[(11Z)-icosenoyl]-sn-glycero-3-phospho-1D-myo-inositol (CHEBI:89243) has functional parent (11Z)-icos-11-enoic acid (CHEBI:32425) |
| 1-docosanoyl-2-[(11Z)-eicosenoyl]-sn-glycero-3-phosphocholine (CHEBI:86215) has functional parent (11Z)-icos-11-enoic acid (CHEBI:32425) |
| 1-eicosanoyl-2-[(11Z)-eicosenoyl]-sn-glycero-3-phosphocholine (CHEBI:86188) has functional parent (11Z)-icos-11-enoic acid (CHEBI:32425) |
| 1-octadecanoyl-2-[(11Z)-eicosenoyl]-sn-glycero-3-phosphocholine (CHEBI:86173) has functional parent (11Z)-icos-11-enoic acid (CHEBI:32425) |
| 1-oleoyl-2-gondoyl-sn-glycerol (CHEBI:84436) has functional parent (11Z)-icos-11-enoic acid (CHEBI:32425) |
| 1-palmitoyl-2-(11Z-eicosenoyl)-sn-glycero-3-phosphocholine (CHEBI:84575) has functional parent (11Z)-icos-11-enoic acid (CHEBI:32425) |
| 1-α-linolenoyl-2-[(11Z)-icosenoyl]-sn-glycerol (CHEBI:89240) has functional parent (11Z)-icos-11-enoic acid (CHEBI:32425) |
| 1,2-di-[(11Z)-eicosenoyl]-sn-glycero-3-phosphocholine (CHEBI:86198) has functional parent (11Z)-icos-11-enoic acid (CHEBI:32425) |
| 2-hydroxygondoic acid (CHEBI:143099) has functional parent (11Z)-icos-11-enoic acid (CHEBI:32425) |
| cholesteryl (11Z)-icosenoate (CHEBI:88795) has functional parent (11Z)-icos-11-enoic acid (CHEBI:32425) |
| ethyl (11Z)-icosenoate (CHEBI:84862) has functional parent (11Z)-icos-11-enoic acid (CHEBI:32425) |
| gondamide (CHEBI:146167) has functional parent (11Z)-icos-11-enoic acid (CHEBI:32425) |
| gondoate (CHEBI:32426) is conjugate base of (11Z)-icos-11-enoic acid (CHEBI:32425) |
| (11Z)-icos-11-enoyl group (CHEBI:32427) is substituent group from (11Z)-icos-11-enoic acid (CHEBI:32425) |
| IUPAC Name |
|---|
| (11Z)-icos-11-enoic acid |
| Synonyms | Source |
|---|---|
| 11-Eicosenoic acid | KEGG COMPOUND |
| 11-Icosenoic acid | KEGG COMPOUND |
| (11Z)-Eicosenoic acid | KEGG COMPOUND |
| (11Z)-Icosenoic acid | KEGG COMPOUND |
| 20:1 | ChEBI |
| Eicosenoic acid | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00035628 | KNApSAcK |
| C16526 | KEGG COMPOUND |
| HMDB0002231 | HMDB |
| LMFA01030085 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1727313 | Reaxys |
| Citations |
|---|