EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H37O2 |
| Net Charge | -1 |
| Average Mass | 309.514 |
| Monoisotopic Mass | 309.27990 |
| SMILES | CCCCCCCC/C=C\CCCCCCCCCC(=O)[O-] |
| InChI | InChI=1S/C20H38O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h9-10H,2-8,11-19H2,1H3,(H,21,22)/p-1/b10-9- |
| InChIKey | BITHHVVYSMSWAG-KTKRTIGZSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (21886157) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gondoate (CHEBI:32426) has role human metabolite (CHEBI:77746) |
| gondoate (CHEBI:32426) has role plant metabolite (CHEBI:76924) |
| gondoate (CHEBI:32426) is a icosanoid anion (CHEBI:62937) |
| gondoate (CHEBI:32426) is a icosenoate (CHEBI:78075) |
| gondoate (CHEBI:32426) is a long-chain fatty acid anion (CHEBI:57560) |
| gondoate (CHEBI:32426) is a unsaturated fatty acid anion (CHEBI:2580) |
| gondoate (CHEBI:32426) is conjugate base of (11Z)-icos-11-enoic acid (CHEBI:32425) |
| Incoming Relation(s) |
| (11Z)-icosenoyl-containing glycerolipid (CHEBI:172956) has functional parent gondoate (CHEBI:32426) |
| (11Z)-icos-11-enoic acid (CHEBI:32425) is conjugate acid of gondoate (CHEBI:32426) |
| IUPAC Name |
|---|
| (11Z)-icos-11-enoate |
| Synonyms | Source |
|---|---|
| 11-(cis)-eiconsenoate | ChEBI |
| (Z)-eicos-11-enoate | ChEBI |
| UniProt Name | Source |
|---|---|
| (11Z)-eicosenoate | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4449786 | Reaxys |