EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H43NO2 |
| Net Charge | 0 |
| Average Mass | 353.591 |
| Monoisotopic Mass | 353.32938 |
| SMILES | CCCCCCCC/C=C\CCCCCCCCCC(=O)NCCO |
| InChI | InChI=1S/C22H43NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-22(25)23-20-21-24/h9-10,24H,2-8,11-21H2,1H3,(H,23,25)/b10-9- |
| InChIKey | YDKRGMXLBRWZJR-KTKRTIGZSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-gondoylethanolamine (CHEBI:73725) has functional parent (11Z)-icos-11-enoic acid (CHEBI:32425) |
| N-gondoylethanolamine (CHEBI:73725) has role metabolite (CHEBI:25212) |
| N-gondoylethanolamine (CHEBI:73725) is a N-(monounsaturated fatty acyl)ethanolamine (CHEBI:85282) |
| N-gondoylethanolamine (CHEBI:73725) is a N-acylethanolamine (CHEBI:52640) |
| N-gondoylethanolamine (CHEBI:73725) is a fatty amide (CHEBI:29348) |
| IUPAC Name |
|---|
| (11Z)-N-(2-hydroxyethyl)icos-11-enamide |
| Synonyms | Source |
|---|---|
| N-(11Z)-eicosaenoylethanolamine | ChEBI |
| N-cis-11-eicosaenoylethanolamine | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| LMFA08040010 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7641807 | Reaxys |