EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H38O3 |
| Net Charge | 0 |
| Average Mass | 326.521 |
| Monoisotopic Mass | 326.28210 |
| SMILES | CCCCCCCC/C=C\CCCCCCCCC(O)C(=O)O |
| InChI | InChI=1S/C20H38O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(21)20(22)23/h9-10,19,21H,2-8,11-18H2,1H3,(H,22,23)/b10-9- |
| InChIKey | BBCCRXOJXZHOGK-KTKRTIGZSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-hydroxygondoic acid (CHEBI:143099) has functional parent (11Z)-icos-11-enoic acid (CHEBI:32425) |
| 2-hydroxygondoic acid (CHEBI:143099) is a 2-hydroxy fatty acid (CHEBI:10283) |
| 2-hydroxygondoic acid (CHEBI:143099) is a hydroxy monounsaturated fatty acid (CHEBI:131869) |
| 2-hydroxygondoic acid (CHEBI:143099) is a long-chain fatty acid (CHEBI:15904) |
| 2-hydroxygondoic acid (CHEBI:143099) is conjugate acid of 2-hydroxygondoate (CHEBI:142987) |
| Incoming Relation(s) |
| 2-hydroxygondoate (CHEBI:142987) is conjugate base of 2-hydroxygondoic acid (CHEBI:143099) |
| IUPAC Name |
|---|
| (11Z)-2-hydroxyicos-11-enoic acid |
| Synonym | Source |
|---|---|
| (Z)-2-hydroxyicos-11-enoic acid | ChEBI |