EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H24FNO4 |
| Net Charge | 0 |
| Average Mass | 421.468 |
| Monoisotopic Mass | 421.16894 |
| SMILES | O=C(O)C[C@H](O)C[C@H](O)/C=C/c1c(C2CC2)nc2ccccc2c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C25H24FNO4/c26-17-9-7-15(8-10-17)24-20-3-1-2-4-22(20)27-25(16-5-6-16)21(24)12-11-18(28)13-19(29)14-23(30)31/h1-4,7-12,16,18-19,28-29H,5-6,13-14H2,(H,30,31)/b12-11+/t18-,19-/m1/s1 |
| InChIKey | VGYFMXBACGZSIL-MCBHFWOFSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | EC 1.1.1.34/EC 1.1.1.88 (hydroxymethylglutaryl-CoA reductase) inhibitor Any EC 1.1.1.* (oxidoreductase acting on donor CH-OH group, NAD+ or NADP+ acceptor) inhibitor that inhibits HMG-CoA reductases. Hydroxymethylglutaryl-CoA reductase inhibitors have been shown to lower directly cholesterol synthesis. The Enzyme Commission designation is EC 1.1.1.34 for the NADPH-dependent enzyme and EC 1.1.1.88 for an NADH-dependent enzyme. |
| Application: | anticholesteremic drug A substance used to lower plasma cholesterol levels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pitavastatin (CHEBI:32020) has role antioxidant (CHEBI:22586) |
| pitavastatin (CHEBI:32020) is a cyclopropanes (CHEBI:51454) |
| pitavastatin (CHEBI:32020) is a dihydroxy monocarboxylic acid (CHEBI:35972) |
| pitavastatin (CHEBI:32020) is a monofluorobenzenes (CHEBI:83575) |
| pitavastatin (CHEBI:32020) is a quinolines (CHEBI:26513) |
| pitavastatin (CHEBI:32020) is a statin (synthetic) (CHEBI:87635) |
| pitavastatin (CHEBI:32020) is conjugate acid of pitavastatin(1−) (CHEBI:71260) |
| Incoming Relation(s) |
| pitavastatin(1−) (CHEBI:71260) is conjugate base of pitavastatin (CHEBI:32020) |
| IUPAC Name |
|---|
| (3R,5S,6E)-7-[2-cyclopropyl-4-(4-fluorophenyl)quinolin-3-yl]-3,5-dihydroxyhept-6-enoic acid |
| INNs | Source |
|---|---|
| pitavastatinum | WHO MedNet |
| pitavastatin | WHO MedNet |
| pitavastatine | WHO MedNet |
| pitavastatia | WHO MedNet |
| Synonyms | Source |
|---|---|
| NK-104 | ChemIDplus |
| NK 104 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C13334 | KEGG COMPOUND |
| US2012016129 | Patent |
| US2011269962 | Patent |
| EP2141155 | Patent |
| HMDB0041991 | HMDB |
| Pitavastatin | Wikipedia |
| 2214 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7257773 | Reaxys |
| CAS:147511-69-1 | ChemIDplus |
| Citations |
|---|