EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H28N7O9PS |
| Net Charge | 0 |
| Average Mass | 573.525 |
| Monoisotopic Mass | 573.14068 |
| SMILES | [H][C@]12CS[C@@H](CCCCC(=O)OP(=O)(O)OC[C@H]3O[C@@H](n4cnc5c(N)ncnc54)[C@H](O)[C@@H]3O)[C@@]1([H])NC(=O)N2 |
| InChI | InChI=1S/C20H28N7O9PS/c21-17-14-18(23-7-22-17)27(8-24-14)19-16(30)15(29)10(35-19)5-34-37(32,33)36-12(28)4-2-1-3-11-13-9(6-38-11)25-20(31)26-13/h7-11,13,15-16,19,29-30H,1-6H2,(H,32,33)(H2,21,22,23)(H2,25,26,31)/t9-,10+,11-,13-,15+,16+,19+/m0/s1 |
| InChIKey | UTQCSTJVMLODHM-RHCAYAJFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| biotinyl-5'-AMP (CHEBI:3110) has functional parent adenosine 5'-monophosphate (CHEBI:16027) |
| biotinyl-5'-AMP (CHEBI:3110) has functional parent biotin (CHEBI:15956) |
| biotinyl-5'-AMP (CHEBI:3110) has role human metabolite (CHEBI:77746) |
| biotinyl-5'-AMP (CHEBI:3110) has role mouse metabolite (CHEBI:75771) |
| biotinyl-5'-AMP (CHEBI:3110) is a purine ribonucleoside 5'-monophosphate (CHEBI:37021) |
| biotinyl-5'-AMP (CHEBI:3110) is conjugate acid of biotinyl-5'-AMP(1−) (CHEBI:62414) |
| Incoming Relation(s) |
| biotinyl-5'-AMP(1−) (CHEBI:62414) is conjugate base of biotinyl-5'-AMP (CHEBI:3110) |
| IUPAC Name |
|---|
| 5'-O-[hydroxy({5-[(3aS,4S,6aR)-2-oxohexahydro-1H-thieno[3,4-d]imidazol-4-yl]pentanoyl}oxy)phosphoryl]adenosine |
| Synonym | Source |
|---|---|
| Biotinyl-5'-AMP | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C05921 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:20733000 | Reaxys |