EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H27N7O9PS |
| Net Charge | -1 |
| Average Mass | 572.517 |
| Monoisotopic Mass | 572.13341 |
| SMILES | [H][C@]12CS[C@@H](CCCCC(=O)OP(=O)([O-])OC[C@H]3O[C@@H](n4cnc5c(N)ncnc54)[C@H](O)[C@@H]3O)[C@@]1([H])NC(=O)N2 |
| InChI | InChI=1S/C20H28N7O9PS/c21-17-14-18(23-7-22-17)27(8-24-14)19-16(30)15(29)10(35-19)5-34-37(32,33)36-12(28)4-2-1-3-11-13-9(6-38-11)25-20(31)26-13/h7-11,13,15-16,19,29-30H,1-6H2,(H,32,33)(H2,21,22,23)(H2,25,26,31)/p-1/t9-,10+,11-,13-,15+,16+,19+/m0/s1 |
| InChIKey | UTQCSTJVMLODHM-RHCAYAJFSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Biological Role: | Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| biotinyl-5'-AMP(1−) (CHEBI:62414) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| biotinyl-5'-AMP(1−) (CHEBI:62414) is a organophosphate oxoanion (CHEBI:58945) |
| biotinyl-5'-AMP(1−) (CHEBI:62414) is conjugate base of biotinyl-5'-AMP (CHEBI:3110) |
| Incoming Relation(s) |
| biotinyl-5'-AMP (CHEBI:3110) is conjugate acid of biotinyl-5'-AMP(1−) (CHEBI:62414) |
| Synonyms | Source |
|---|---|
| biotinyl-5'-adenylate (1−) | SUBMITTER |
| biotinyl-5'-adenylate | MetaCyc |
| UniProt Name | Source |
|---|---|
| biotinyl-5'-AMP | UniProt |
| Manual Xrefs | Databases |
|---|---|
| BIO-5-AMP | MetaCyc |