EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H5N2O4 |
| Net Charge | -1 |
| Average Mass | 157.105 |
| Monoisotopic Mass | 157.02548 |
| SMILES | O=C1CC(C(=O)[O-])NC(=O)N1 |
| InChI | InChI=1S/C5H6N2O4/c8-3-1-2(4(9)10)6-5(11)7-3/h2H,1H2,(H,9,10)(H2,6,7,8,11)/p-1 |
| InChIKey | UFIVEPVSAGBUSI-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dihydroorotate (CHEBI:30867) has functional parent orotate (CHEBI:30839) |
| dihydroorotate (CHEBI:30867) is a monocarboxylic acid anion (CHEBI:35757) |
| dihydroorotate (CHEBI:30867) is conjugate base of dihydroorotic acid (CHEBI:30865) |
| Incoming Relation(s) |
| (S)-dihydroorotate (CHEBI:30864) is a dihydroorotate (CHEBI:30867) |
| dihydroorotic acid (CHEBI:30865) is conjugate acid of dihydroorotate (CHEBI:30867) |
| IUPAC Name |
|---|
| 2,6-dioxohexahydropyrimidine-4-carboxylate |
| Synonym | Source |
|---|---|
| 4,5-dihydroorotate | ChEBI |