EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H6N2O4 |
| Net Charge | 0 |
| Average Mass | 158.113 |
| Monoisotopic Mass | 158.03276 |
| SMILES | O=C1CC(C(=O)O)NC(=O)N1 |
| InChI | InChI=1S/C5H6N2O4/c8-3-1-2(4(9)10)6-5(11)7-3/h2H,1H2,(H,9,10)(H2,6,7,8,11) |
| InChIKey | UFIVEPVSAGBUSI-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dihydroorotic acid (CHEBI:30865) has functional parent orotic acid (CHEBI:16742) |
| dihydroorotic acid (CHEBI:30865) is a N-acylurea (CHEBI:74266) |
| dihydroorotic acid (CHEBI:30865) is a monocarboxylic acid (CHEBI:25384) |
| dihydroorotic acid (CHEBI:30865) is a pyrimidinemonocarboxylic acid (CHEBI:26447) |
| dihydroorotic acid (CHEBI:30865) is a secondary amide (CHEBI:33257) |
| dihydroorotic acid (CHEBI:30865) is conjugate acid of dihydroorotate (CHEBI:30867) |
| Incoming Relation(s) |
| (R)-dihydroorotic acid (CHEBI:30866) is a dihydroorotic acid (CHEBI:30865) |
| (S)-dihydroorotic acid (CHEBI:17025) is a dihydroorotic acid (CHEBI:30865) |
| dihydroorotate (CHEBI:30867) is conjugate base of dihydroorotic acid (CHEBI:30865) |
| IUPAC Name |
|---|
| 2,6-dioxohexahydropyrimidine-4-carboxylic acid |
| Synonyms | Source |
|---|---|
| 4,5-dihydroorotic acid | ChemIDplus |
| 5,6-dihydro-orotic acid | ChEBI |
| Hydroorotic acid | ChemIDplus |
| DL-dihydroortotic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 4,5-Dihydroorotic_acid | Wikipedia |
| DB02129 | DrugBank |
| US2773872 | Patent |
| Registry Numbers | Sources |
|---|---|
| Beilstein:155267 | Beilstein |
| Reaxys:83959 | Reaxys |
| CAS:155-54-4 | ChemIDplus |