EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:30839 - orotate
| Formula | C5H3N2O4 |
| Net Charge | -1 |
| Average Mass | 155.089 |
| Monoisotopic Mass | 155.00983 |
| SMILES | O=C([O-])c1cc(=O)nc(=O)n1 |
| InChI | InChI=1S/C5H4N2O4/c8-3-1-2(4(9)10)6-5(11)7-3/h1H,(H,9,10)(H2,6,7,8,11)/p-1 |
| InChIKey | PXQPEWDEAKTCGB-UHFFFAOYSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| orotate (CHEBI:30839) has functional parent uracil (CHEBI:17568) |
| orotate (CHEBI:30839) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| orotate (CHEBI:30839) has role human metabolite (CHEBI:77746) |
| orotate (CHEBI:30839) is a pyrimidinecarboxylate anion (CHEBI:38316) |
| orotate (CHEBI:30839) is conjugate base of orotic acid (CHEBI:16742) |
| Incoming Relation(s) |
| dihydroorotate (CHEBI:30867) has functional parent orotate (CHEBI:30839) |
| sodium orotate (CHEBI:132101) has part orotate (CHEBI:30839) |
| orotic acid (CHEBI:16742) is conjugate acid of orotate (CHEBI:30839) |
| IUPAC Name |
|---|
| 2,6-dioxo-1,2,3,6-tetrahydropyrimidine-4-carboxylate |
| UniProt Name | Source |
|---|---|
| orotate | UniProt |
| Registry Numbers | Sources |
|---|---|
| Beilstein:3651747 | Beilstein |
| Gmelin:464718 | Gmelin |
| CAS:73-97-2 | Beilstein |