EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H5N2O4 |
| Net Charge | -1 |
| Average Mass | 157.105 |
| Monoisotopic Mass | 157.02548 |
| SMILES | O=C1C[C@@H](C(=O)[O-])NC(=O)N1 |
| InChI | InChI=1S/C5H6N2O4/c8-3-1-2(4(9)10)6-5(11)7-3/h2H,1H2,(H,9,10)(H2,6,7,8,11)/p-1/t2-/m0/s1 |
| InChIKey | UFIVEPVSAGBUSI-REOHCLBHSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-dihydroorotate (CHEBI:30864) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| (S)-dihydroorotate (CHEBI:30864) has role human metabolite (CHEBI:77746) |
| (S)-dihydroorotate (CHEBI:30864) is a dihydroorotate (CHEBI:30867) |
| (S)-dihydroorotate (CHEBI:30864) is conjugate base of (S)-dihydroorotic acid (CHEBI:17025) |
| Incoming Relation(s) |
| (S)-dihydroorotic acid (CHEBI:17025) is conjugate acid of (S)-dihydroorotate (CHEBI:30864) |
| IUPAC Name |
|---|
| (4S)-2,6-dioxohexahydropyrimidine-4-carboxylate |
| Synonyms | Source |
|---|---|
| 4,5-dihydro-L-orotate | ChEBI |
| (S)-4,5-dihydroorotate | ChEBI |
| UniProt Name | Source |
|---|---|
| (S)-dihydroorotate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| DI-H-OROTATE | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Gmelin:1484350 | Gmelin |