EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H4N2O4 |
| Net Charge | 0 |
| Average Mass | 156.097 |
| Monoisotopic Mass | 156.01711 |
| SMILES | O=C(O)c1cc(=O)nc(=O)n1 |
| InChI | InChI=1S/C5H4N2O4/c8-3-1-2(4(9)10)6-5(11)7-3/h1H,(H,9,10)(H2,6,7,8,11) |
| InChIKey | PXQPEWDEAKTCGB-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| orotic acid (CHEBI:16742) has functional parent uracil (CHEBI:17568) |
| orotic acid (CHEBI:16742) has role Escherichia coli metabolite (CHEBI:76971) |
| orotic acid (CHEBI:16742) has role metabolite (CHEBI:25212) |
| orotic acid (CHEBI:16742) has role mouse metabolite (CHEBI:75771) |
| orotic acid (CHEBI:16742) is a pyrimidinemonocarboxylic acid (CHEBI:26447) |
| orotic acid (CHEBI:16742) is conjugate acid of orotate (CHEBI:30839) |
| Incoming Relation(s) |
| N-[(2,6-dioxo-1,2,3,6-tetrahydropyrimidin-4-yl)carbonyl]-β-alanine (CHEBI:156205) has functional parent orotic acid (CHEBI:16742) |
| dihydroorotic acid (CHEBI:30865) has functional parent orotic acid (CHEBI:16742) |
| methyl N-[(2,6-dioxo-1,2,3,6-tetrahydropyrimidin-4-yl)carbonyl]-β-alaninate (CHEBI:156206) has functional parent orotic acid (CHEBI:16742) |
| orotate (CHEBI:30839) is conjugate base of orotic acid (CHEBI:16742) |
| IUPAC Name |
|---|
| 2,6-dioxo-1,2,3,6-tetrahydropyrimidine-4-carboxylic acid |
| Synonyms | Source |
|---|---|
| Orotic acid | KEGG COMPOUND |
| Uracil-6-carboxylic acid | KEGG COMPOUND |
| OROTIC ACID | PDBeChem |
| Orotsäure | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00295 | KEGG COMPOUND |
| ORO | PDBeChem |
| DB02262 | DrugBank |
| HMDB0000226 | HMDB |
| OROTATE | MetaCyc |
| Orotic_acid | Wikipedia |
| D00055 | KEGG DRUG |
| C00019689 | KNApSAcK |
| 3402 | DrugCentral |
| Citations |
|---|