EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H6N2O4 |
| Net Charge | 0 |
| Average Mass | 158.113 |
| Monoisotopic Mass | 158.03276 |
| SMILES | O=C1C[C@@H](C(=O)O)NC(=O)N1 |
| InChI | InChI=1S/C5H6N2O4/c8-3-1-2(4(9)10)6-5(11)7-3/h2H,1H2,(H,9,10)(H2,6,7,8,11)/t2-/m0/s1 |
| InChIKey | UFIVEPVSAGBUSI-REOHCLBHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-dihydroorotic acid (CHEBI:17025) has role Escherichia coli metabolite (CHEBI:76971) |
| (S)-dihydroorotic acid (CHEBI:17025) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| (S)-dihydroorotic acid (CHEBI:17025) has role human metabolite (CHEBI:77746) |
| (S)-dihydroorotic acid (CHEBI:17025) has role mouse metabolite (CHEBI:75771) |
| (S)-dihydroorotic acid (CHEBI:17025) is a dihydroorotic acid (CHEBI:30865) |
| (S)-dihydroorotic acid (CHEBI:17025) is conjugate acid of (S)-dihydroorotate (CHEBI:30864) |
| (S)-dihydroorotic acid (CHEBI:17025) is enantiomer of (R)-dihydroorotic acid (CHEBI:30866) |
| Incoming Relation(s) |
| (S)-dihydroorotate (CHEBI:30864) is conjugate base of (S)-dihydroorotic acid (CHEBI:17025) |
| (R)-dihydroorotic acid (CHEBI:30866) is enantiomer of (S)-dihydroorotic acid (CHEBI:17025) |
| IUPAC Name |
|---|
| (4S)-2,6-dioxohexahydropyrimidine-4-carboxylic acid |
| Synonyms | Source |
|---|---|
| Dihydro-L-orotic acid | KEGG COMPOUND |
| L-Dihydroorotic acid | KEGG COMPOUND |
| (S)-4,5-dihydroorotic acid | ChEBI |
| Citations |
|---|