EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H11NO4 |
| Net Charge | 0 |
| Average Mass | 161.157 |
| Monoisotopic Mass | 161.06881 |
| SMILES | CC(=O)OCC[C@@H](N)C(=O)O |
| InChI | InChI=1S/C6H11NO4/c1-4(8)11-3-2-5(7)6(9)10/h5H,2-3,7H2,1H3,(H,9,10)/t5-/m1/s1 |
| InChIKey | FCXZBWSIAGGPCB-RXMQYKEDSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| O-acetyl-D-homoserine (CHEBI:37034) has functional parent D-homoserine (CHEBI:30654) |
| O-acetyl-D-homoserine (CHEBI:37034) is a O-acetylhomoserine (CHEBI:7671) |
| O-acetyl-D-homoserine (CHEBI:37034) is enantiomer of O-acetyl-L-homoserine (CHEBI:16288) |
| Incoming Relation(s) |
| O-acetyl-L-homoserine (CHEBI:16288) is enantiomer of O-acetyl-D-homoserine (CHEBI:37034) |
| IUPAC Name |
|---|
| (2R)-4-(acetyloxy)-2-aminobutanoic acid |
| Registry Numbers | Sources |
|---|---|
| Beilstein:6966159 | Beilstein |