EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H11NO4 |
| Net Charge | 0 |
| Average Mass | 161.157 |
| Monoisotopic Mass | 161.06881 |
| SMILES | CC(=O)OCCC(N)C(=O)O |
| InChI | InChI=1S/C6H11NO4/c1-4(8)11-3-2-5(7)6(9)10/h5H,2-3,7H2,1H3,(H,9,10) |
| InChIKey | FCXZBWSIAGGPCB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| O-acetylhomoserine (CHEBI:7671) has functional parent homoserine (CHEBI:30653) |
| O-acetylhomoserine (CHEBI:7671) is a acetate ester (CHEBI:47622) |
| O-acetylhomoserine (CHEBI:7671) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| O-acetylhomoserine (CHEBI:7671) is tautomer of O-acetylhomoserine zwitterion (CHEBI:132989) |
| Incoming Relation(s) |
| O-acetyl-D-homoserine (CHEBI:37034) is a O-acetylhomoserine (CHEBI:7671) |
| O-acetyl-L-homoserine (CHEBI:16288) is a O-acetylhomoserine (CHEBI:7671) |
| O-acetylhomoserine zwitterion (CHEBI:132989) is tautomer of O-acetylhomoserine (CHEBI:7671) |
| IUPAC Name |
|---|
| 4-(acetyloxy)-2-aminobutanoic acid |
| Synonym | Source |
|---|---|
| O-Acetylhomoserine | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| HMDB0029423 | HMDB |
| FDB000523 | FooDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1724343 | Reaxys |