EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H12N5O13P3 |
| Net Charge | -4 |
| Average Mass | 503.150 |
| Monoisotopic Mass | 502.96664 |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C10H16N5O13P3/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(17)6(16)4(26-10)1-25-30(21,22)28-31(23,24)27-29(18,19)20/h2-4,6-7,10,16-17H,1H2,(H,21,22)(H,23,24)(H2,11,12,13)(H2,18,19,20)/p-4/t4-,6-,7-,10-/m1/s1 |
| InChIKey | ZKHQWZAMYRWXGA-KQYNXXCUSA-J |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Biological Roles: | cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). fundamental metabolite Any metabolite produced by all living cells. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ATP(4−) (CHEBI:30616) has role cofactor (CHEBI:23357) |
| ATP(4−) (CHEBI:30616) has role fundamental metabolite (CHEBI:78675) |
| ATP(4−) (CHEBI:30616) has role human metabolite (CHEBI:77746) |
| ATP(4−) (CHEBI:30616) is a nucleoside 5'-triphoshate(4−) (CHEBI:61557) |
| ATP(4−) (CHEBI:30616) is conjugate base of ATP(3−) (CHEBI:57299) |
| Incoming Relation(s) |
| 8-oxo-ATP(4−) (CHEBI:189076) has functional parent ATP(4−) (CHEBI:30616) |
| 9-ribosyl-trans-zeatin 5'-triphosphate(4−) (CHEBI:87953) has functional parent ATP(4−) (CHEBI:30616) |
| TNP-ATP5− (CHEBI:50105) has functional parent ATP(4−) (CHEBI:30616) |
| ATP(3−) (CHEBI:57299) is conjugate acid of ATP(4−) (CHEBI:30616) |
| IUPAC Name |
|---|
| adenosine 5'-triphosphate(4−) |
| Synonym | Source |
|---|---|
| atp | IUPAC |
| UniProt Name | Source |
|---|---|
| ATP | UniProt |
| Registry Numbers | Sources |
|---|---|
| Gmelin:342798 | Gmelin |
| Beilstein:3581767 | Beilstein |