EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H20N5O14P3 |
| Net Charge | -4 |
| Average Mass | 587.268 |
| Monoisotopic Mass | 587.02415 |
| SMILES | C/C(=C\CNc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])[C@@H](O)[C@H]1O)CO |
| InChI | InChI=1S/C15H24N5O14P3/c1-8(4-21)2-3-16-13-10-14(18-6-17-13)20(7-19-10)15-12(23)11(22)9(32-15)5-31-36(27,28)34-37(29,30)33-35(24,25)26/h2,6-7,9,11-12,15,21-23H,3-5H2,1H3,(H,27,28)(H,29,30)(H,16,17,18)(H2,24,25,26)/p-4/b8-2+/t9-,11-,12-,15-/m1/s1 |
| InChIKey | AOFQQLZNDSBFLN-HNNGNKQASA-J |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 9-ribosyl-trans-zeatin 5'-triphosphate(4−) (CHEBI:87953) has functional parent ATP(4−) (CHEBI:30616) |
| 9-ribosyl-trans-zeatin 5'-triphosphate(4−) (CHEBI:87953) is a organophosphate oxoanion (CHEBI:58945) |
| 9-ribosyl-trans-zeatin 5'-triphosphate(4−) (CHEBI:87953) is conjugate base of 9-ribosyl-trans-zeatin 5'-triphosphate (CHEBI:71938) |
| Incoming Relation(s) |
| 9-ribosyl-trans-zeatin 5'-triphosphate (CHEBI:71938) is conjugate acid of 9-ribosyl-trans-zeatin 5'-triphosphate(4−) (CHEBI:87953) |
| IUPAC Name |
|---|
| N-[(2E)-4-hydroxy-3-methylbut-2-en-1-yl]-5'-O-({[(phosphonatooxy)phosphinato]oxy}phosphinato)adenosine |
| UniProt Name | Source |
|---|---|
| 9-ribosyl-trans-zeatin 5'-triphosphate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-4202 | MetaCyc |
| Citations |
|---|