EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H8O6 |
| Net Charge | -2 |
| Average Mass | 224.168 |
| Monoisotopic Mass | 224.03319 |
| SMILES | [H][C@]1(O)C=C[C@@](CC(=O)C(=O)[O-])(C(=O)[O-])C=C1 |
| InChI | InChI=1S/C10H10O6/c11-6-1-3-10(4-2-6,9(15)16)5-7(12)8(13)14/h1-4,6,11H,5H2,(H,13,14)(H,15,16)/p-2/t6-,10+ |
| InChIKey | FPWMCUPFBRFMLH-XGAOUMNUSA-L |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Biological Roles: | Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (1s,4s)-prephenate(2−) (CHEBI:29934) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| (1s,4s)-prephenate(2−) (CHEBI:29934) is a prephenate(2−) (CHEBI:57852) |
| (1s,4s)-prephenate(2−) (CHEBI:29934) is conjugate base of (1s,4s)-prephenic acid (CHEBI:84387) |
| (1s,4s)-prephenate(2−) (CHEBI:29934) is conjugate base of prephenic acid (CHEBI:16666) |
| Incoming Relation(s) |
| (1s,4s)-prephenic acid (CHEBI:84387) is conjugate acid of (1s,4s)-prephenate(2−) (CHEBI:29934) |
| prephenic acid (CHEBI:16666) is conjugate acid of (1s,4s)-prephenate(2−) (CHEBI:29934) |
| IUPAC Names |
|---|
| (1s,4s)-1-(2-carboxylato-2-oxoethyl)-4-hydroxycyclohexa-2,5-diene-1-carboxylate |
| cis-1-(2-carboxylato-2-oxoethyl)-4-hydroxycyclohexa-2,5-diene-1-carboxylate |
| Synonym | Source |
|---|---|
| cis-prephenate | ChEBI |
| UniProt Name | Source |
|---|---|
| prephenate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00254 | KEGG COMPOUND |
| PREPHENATE | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3682733 | Reaxys |