EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H8O6 |
| Net Charge | -2 |
| Average Mass | 224.168 |
| Monoisotopic Mass | 224.03319 |
| SMILES | O=C([O-])C(=O)CC1(C(=O)[O-])C=CC(O)C=C1 |
| InChI | InChI=1S/C10H10O6/c11-6-1-3-10(4-2-6,9(15)16)5-7(12)8(13)14/h1-4,6,11H,5H2,(H,13,14)(H,15,16)/p-2 |
| InChIKey | FPWMCUPFBRFMLH-UHFFFAOYSA-L |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (17765195) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| prephenate(2−) (CHEBI:57852) has role Escherichia coli metabolite (CHEBI:76971) |
| prephenate(2−) (CHEBI:57852) has role plant metabolite (CHEBI:76924) |
| prephenate(2−) (CHEBI:57852) is a dicarboxylic acid dianion (CHEBI:28965) |
| prephenate(2−) (CHEBI:57852) is conjugate base of prephenic acid (CHEBI:16666) |
| Incoming Relation(s) |
| (1s,4s)-prephenate(2−) (CHEBI:29934) is a prephenate(2−) (CHEBI:57852) |
| prephenic acid (CHEBI:16666) is conjugate acid of prephenate(2−) (CHEBI:57852) |
| IUPAC Name |
|---|
| 1-(2-carboxylato-2-oxoethyl)-4-hydroxycyclohexa-2,5-diene-1-carboxylate |
| Synonyms | Source |
|---|---|
| prephenate | ChEBI |
| prephenate dianion | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:5288208 | Beilstein |