EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H10O6 |
| Net Charge | 0 |
| Average Mass | 226.184 |
| Monoisotopic Mass | 226.04774 |
| SMILES | [H][C@]1(O)C=C[C@@](CC(=O)C(=O)O)(C(=O)O)C=C1 |
| InChI | InChI=1S/C10H10O6/c11-6-1-3-10(4-2-6,9(15)16)5-7(12)8(13)14/h1-4,6,11H,5H2,(H,13,14)(H,15,16)/t6-,10+ |
| InChIKey | FPWMCUPFBRFMLH-XGAOUMNUSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (1s,4s)-prephenic acid (CHEBI:84387) is a prephenic acid (CHEBI:16666) |
| (1s,4s)-prephenic acid (CHEBI:84387) is conjugate acid of (1s,4s)-prephenate(2−) (CHEBI:29934) |
| Incoming Relation(s) |
| (1s,4s)-prephenate(2−) (CHEBI:29934) is conjugate base of (1s,4s)-prephenic acid (CHEBI:84387) |
| IUPAC Names |
|---|
| (1s,4s)-1-(2-carboxy-2-oxoethyl)-4-hydroxycyclohexa-2,5-diene-1-carboxylic acid |
| cis-1-(2-carboxy-2-oxoethyl)-4-hydroxycyclohexa-2,5-diene-1-carboxylic acid |
| Synonyms | Source |
|---|---|
| cis-1-Carboxy-4-hydroxy-alpha-oxo-2,5-cyclohexadiene-1-propanoic acid | ChemIDplus |
| cis-prephenic acid | ChEBI |
| Prephenic acid, cis | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C00254 | KEGG COMPOUND |
| PREPHENATE | MetaCyc |
| Prephenic_acid | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2698271 | Reaxys |
| CAS:126-49-8 | KEGG COMPOUND |
| CAS:87664-40-2 | ChemIDplus |