EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H10O6 |
| Net Charge | 0 |
| Average Mass | 226.184 |
| Monoisotopic Mass | 226.04774 |
| SMILES | O=C(O)C(=O)CC1(C(=O)O)C=CC(O)C=C1 |
| InChI | InChI=1S/C10H10O6/c11-6-1-3-10(4-2-6,9(15)16)5-7(12)8(13)14/h1-4,6,11H,5H2,(H,13,14)(H,15,16) |
| InChIKey | FPWMCUPFBRFMLH-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (17765195) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| prephenic acid (CHEBI:16666) has role Escherichia coli metabolite (CHEBI:76971) |
| prephenic acid (CHEBI:16666) has role plant metabolite (CHEBI:76924) |
| prephenic acid (CHEBI:16666) is a oxo dicarboxylic acid (CHEBI:36145) |
| prephenic acid (CHEBI:16666) is conjugate acid of (1s,4s)-prephenate(2−) (CHEBI:29934) |
| prephenic acid (CHEBI:16666) is conjugate acid of prephenate(2−) (CHEBI:57852) |
| Incoming Relation(s) |
| (1s,4s)-prephenic acid (CHEBI:84387) is a prephenic acid (CHEBI:16666) |
| (1s,4s)-prephenate(2−) (CHEBI:29934) is conjugate base of prephenic acid (CHEBI:16666) |
| prephenate(2−) (CHEBI:57852) is conjugate base of prephenic acid (CHEBI:16666) |
| Synonyms | Source |
|---|---|
| 1-Carboxy-4-hydroxy-2,5-cyclohexadiene-1-pyruvic acid | ChemIDplus |
| 1-carboxy-4-hydroxy-α-oxo-2,5-cyclohexadiene-1-propanoic acid | ChemIDplus |
| Prephenic acid | KEGG COMPOUND |
| PREPHENIC ACID | PDBeChem |
| Manual Xrefs | Databases |
|---|---|
| C00019632 | KNApSAcK |
| DB08427 | DrugBank |
| HMDB0012283 | HMDB |
| PRE | PDBeChem |
| Prephenic_acid | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2698270 | Reaxys |
| CAS:126-49-8 | ChemIDplus |
| Citations |
|---|