EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H36O5 |
| Net Charge | 0 |
| Average Mass | 356.503 |
| Monoisotopic Mass | 356.25627 |
| SMILES | CCCCC[C@H](O)/C=C/[C@@H]1[C@@H](CCCCCCC(=O)O)[C@@H](O)C[C@H]1O |
| InChI | InChI=1S/C20H36O5/c1-2-3-6-9-15(21)12-13-17-16(18(22)14-19(17)23)10-7-4-5-8-11-20(24)25/h12-13,15-19,21-23H,2-11,14H2,1H3,(H,24,25)/b13-12+/t15-,16+,17+,18-,19+/m0/s1 |
| InChIKey | DZUXGQBLFALXCR-CDIPTNKSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| prostaglandin F1α (CHEBI:28852) has role human metabolite (CHEBI:77746) |
| prostaglandin F1α (CHEBI:28852) is a prostaglandins Fα (CHEBI:36066) |
| Incoming Relation(s) |
| 13,14-dihydro-15-keto-PGF1α (CHEBI:134509) has functional parent prostaglandin F1α (CHEBI:28852) |
| 15-ketoprostaglandin F1α (CHEBI:72593) has functional parent prostaglandin F1α (CHEBI:28852) |
| 2,3-dinor-6-oxoprostaglandin F1α (CHEBI:73944) has functional parent prostaglandin F1α (CHEBI:28852) |
| 2,3-dinor-8-epi-prostaglandin F1α (CHEBI:34229) has functional parent prostaglandin F1α (CHEBI:28852) |
| 6-oxoprostaglandin F1α (CHEBI:28158) has functional parent prostaglandin F1α (CHEBI:28852) |
| 6,15-diketo,13,14-dihydroprostaglandin F1α (CHEBI:72595) has functional parent prostaglandin F1α (CHEBI:28852) |
| prostaglandin F1α alcohol (CHEBI:133875) has functional parent prostaglandin F1α (CHEBI:28852) |
| prostaglandin F1alpha (1-) (CHEBI:133421) is conjugate base of prostaglandin F1α (CHEBI:28852) |
| IUPAC Name |
|---|
| (13E,15S)-9α,11α,15-trihydroxyprost-13-en-1-oic acid |
| Synonyms | Source |
|---|---|
| (13E,15S)-9alpha,11alpha-9,11,15-Trihydroxyprost-13-en-1-oic acid | KEGG COMPOUND |
| PGF 1-alpha | ChemIDplus |
| Prostaglandin F1 | ChemIDplus |
| Prostaglandin f1-alpha | ChemIDplus |
| Prostaglandin F1alpha | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C06475 | KEGG COMPOUND |
| LMFA03010137 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:745-62-0 | KEGG COMPOUND |
| CAS:745-62-0 | ChemIDplus |