EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H34O6 |
| Net Charge | 0 |
| Average Mass | 370.486 |
| Monoisotopic Mass | 370.23554 |
| SMILES | CCCCC[C@H](O)/C=C/[C@@H]1[C@@H](CC(=O)CCCCC(=O)O)[C@@H](O)C[C@H]1O |
| InChI | InChI=1S/C20H34O6/c1-2-3-4-7-14(21)10-11-16-17(19(24)13-18(16)23)12-15(22)8-5-6-9-20(25)26/h10-11,14,16-19,21,23-24H,2-9,12-13H2,1H3,(H,25,26)/b11-10+/t14-,16+,17+,18+,19-/m0/s1 |
| InChIKey | KFGOFTHODYBSGM-ZUNNJUQCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Mus musculus (ncbitaxon:10090) | - | MetaboLights (MTBLS143) |
| Roles Classification |
|---|
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-oxoprostaglandin F1α (CHEBI:28158) has functional parent prostaglandin F1α (CHEBI:28852) |
| 6-oxoprostaglandin F1α (CHEBI:28158) has role human metabolite (CHEBI:77746) |
| 6-oxoprostaglandin F1α (CHEBI:28158) has role mouse metabolite (CHEBI:75771) |
| 6-oxoprostaglandin F1α (CHEBI:28158) is a prostaglandins Fα (CHEBI:36066) |
| 6-oxoprostaglandin F1α (CHEBI:28158) is conjugate acid of 6-oxoprostaglandin F1α(1−) (CHEBI:133451) |
| Incoming Relation(s) |
| 6-oxoprostaglandin F1α(1−) (CHEBI:133451) is conjugate base of 6-oxoprostaglandin F1α (CHEBI:28158) |
| IUPAC Name |
|---|
| (13E,15S)-9α,11α,15-trihydroxy-6-oxoprost-13-en-1-oic acid |
| Synonyms | Source |
|---|---|
| 6-Keto-prostaglandin F1alpha | KEGG COMPOUND |
| 6-Keto-prostaglandin F1a | KEGG COMPOUND |
| 6-Keto-PGF1alpha | KEGG COMPOUND |
| 6-Keto-PGF1a | KEGG COMPOUND |
| 6-Ketoprostaglandin F1alpha | ChemIDplus |
| 6-Oxo-PGF1alpha | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C05961 | KEGG COMPOUND |
| LMFA03010001 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2821925 | Reaxys |
| CAS:58962-34-8 | ChemIDplus |
| CAS:58962-34-8 | KEGG COMPOUND |
| Citations |
|---|