EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32O6 |
| Net Charge | 0 |
| Average Mass | 368.470 |
| Monoisotopic Mass | 368.21989 |
| SMILES | CCCCCC(=O)/C=C/[C@@H]1[C@@H](CC(=O)CCCCC(=O)O)[C@@H](O)C[C@H]1O |
| InChI | InChI=1S/C20H32O6/c1-2-3-4-7-14(21)10-11-16-17(19(24)13-18(16)23)12-15(22)8-5-6-9-20(25)26/h10-11,16-19,23-24H,2-9,12-13H2,1H3,(H,25,26)/b11-10+/t16-,17-,18-,19+/m1/s1 |
| InChIKey | VKPWUQVGTPVEMU-QVPQFPIISA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6,15-diketo,13,14-dihydroprostaglandin F1α (CHEBI:72595) has functional parent prostaglandin F1α (CHEBI:28852) |
| 6,15-diketo,13,14-dihydroprostaglandin F1α (CHEBI:72595) has role metabolite (CHEBI:25212) |
| 6,15-diketo,13,14-dihydroprostaglandin F1α (CHEBI:72595) is a prostaglandins Fα (CHEBI:36066) |
| IUPAC Name |
|---|
| (9α,11α,13E)-9,11-dihydroxy-6,15-dioxoprost-13-en-1-oic acid |
| Synonyms | Source |
|---|---|
| 6,15-dioxo-9S,11R-dihydroxy-13E-prostenoic acid | LIPID MAPS |
| 6,15dk,13,14dh-PGF1a | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0001979 | HMDB |
| LMFA03010013 | LIPID MAPS |