EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H30O6 |
| Net Charge | 0 |
| Average Mass | 342.432 |
| Monoisotopic Mass | 342.20424 |
| SMILES | CCCCC[C@H](O)/C=C/[C@@H]1[C@@H](CC(=O)CCC(=O)O)[C@@H](O)C[C@H]1O |
| InChI | InChI=1S/C18H30O6/c1-2-3-4-5-12(19)6-8-14-15(17(22)11-16(14)21)10-13(20)7-9-18(23)24/h6,8,12,14-17,19,21-22H,2-5,7,9-11H2,1H3,(H,23,24)/b8-6+/t12-,14+,15+,16+,17-/m0/s1 |
| InChIKey | DNKGWNLXBRCUCF-NLOSNHEGSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,3-dinor-6-oxoprostaglandin F1α (CHEBI:73944) has functional parent prostaglandin F1α (CHEBI:28852) |
| 2,3-dinor-6-oxoprostaglandin F1α (CHEBI:73944) has role metabolite (CHEBI:25212) |
| 2,3-dinor-6-oxoprostaglandin F1α (CHEBI:73944) is a 4-oxo monocarboxylic acid (CHEBI:35950) |
| 2,3-dinor-6-oxoprostaglandin F1α (CHEBI:73944) is a prostanoid (CHEBI:26347) |
| 2,3-dinor-6-oxoprostaglandin F1α (CHEBI:73944) is a secondary alcohol (CHEBI:35681) |
| Incoming Relation(s) |
| 19-hydroxy-2,3-dinor-6-oxoprostaglandin F1α (CHEBI:73951) has functional parent 2,3-dinor-6-oxoprostaglandin F1α (CHEBI:73944) |
| IUPAC Names |
|---|
| (13E,15S)-9α,11α,15-trihydroxy-2,3-dinor-6-oxoprost-13-en-1-oic acid |
| 5-{(1R,2R,3R,5S)-3,5-dihydroxy-2-[(1E,3S)-3-hydroxyoct-1-en-1-yl]cyclopentyl}-4-oxopentanoic acid |
| Synonyms | Source |
|---|---|
| 2,3-dinor, 6-keto-PGF1α | LIPID MAPS |
| 2,3-dinor-6-keto-pgf1α | ChemIDplus |
| 2,3-dinor-6-keto-PGF1α | ChEBI |
| 2,3-dinor-6-ketoprostaglandin F1α | ChemIDplus |
| 2,3-dinor-6-oxo-pgf1α | ChemIDplus |
| 2,3-dinor-6-oxo-PGF1α | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0002277 | HMDB |
| LMFA03010089 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4540372 | Reaxys |
| CAS:64700-71-6 | ChemIDplus |
| Citations |
|---|