EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H12O4 |
| Net Charge | 0 |
| Average Mass | 244.246 |
| Monoisotopic Mass | 244.07356 |
| SMILES | Oc1cc(O)cc(/C=C/c2ccc(O)c(O)c2)c1 |
| InChI | InChI=1S/C14H12O4/c15-11-5-10(6-12(16)8-11)2-1-9-3-4-13(17)14(18)7-9/h1-8,15-18H/b2-1+ |
| InChIKey | CDRPUGZCRXZLFL-OWOJBTEDSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | tyrosine kinase inhibitor Any protein kinase inhibitor that interferes with the action of tyrosine kinase. protein kinase inhibitor An EC 2.7.* (P-containing group transferase) inhibitor that interferes with the action of protein kinases. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Applications: | hypoglycemic agent A drug which lowers the blood glucose level. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| piceatannol (CHEBI:28814) has parent hydride trans-stilbene (CHEBI:36007) |
| piceatannol (CHEBI:28814) has role antineoplastic agent (CHEBI:35610) |
| piceatannol (CHEBI:28814) has role apoptosis inducer (CHEBI:68495) |
| piceatannol (CHEBI:28814) has role geroprotector (CHEBI:176497) |
| piceatannol (CHEBI:28814) has role hypoglycemic agent (CHEBI:35526) |
| piceatannol (CHEBI:28814) has role plant metabolite (CHEBI:76924) |
| piceatannol (CHEBI:28814) has role protein kinase inhibitor (CHEBI:37699) |
| piceatannol (CHEBI:28814) has role tyrosine kinase inhibitor (CHEBI:38637) |
| piceatannol (CHEBI:28814) is a catechols (CHEBI:33566) |
| piceatannol (CHEBI:28814) is a polyphenol (CHEBI:26195) |
| piceatannol (CHEBI:28814) is a resorcinols (CHEBI:33572) |
| piceatannol (CHEBI:28814) is a stilbenol (CHEBI:36027) |
| Incoming Relation(s) |
| trans-astringin (CHEBI:2899) has functional parent piceatannol (CHEBI:28814) |
| isorhapontigenin (CHEBI:167830) has functional parent piceatannol (CHEBI:28814) |
| piceatannolquinone (CHEBI:232396) has functional parent piceatannol (CHEBI:28814) |
| rhapontigenin (CHEBI:174376) has functional parent piceatannol (CHEBI:28814) |
| IUPAC Name |
|---|
| 4-[(1E)-2-(3,5-dihydroxyphenyl)ethenyl]benzene-1,2-diol |
| Synonyms | Source |
|---|---|
| 3,3',4'5-Tetrahydroxystilbene | KEGG COMPOUND |
| 3,5,3',4'-tetrahydroxystilbene | ChemIDplus |
| 3-hydroxyresveratol | ChemIDplus |
| 4-[(E)-2-(3,5-dihydroxyphenyl)vinyl]benzene-1,2-diol | ChEBI |
| Piceatannol | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| piceatannol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00002895 | KNApSAcK |
| C05901 | KEGG COMPOUND |
| DB08399 | DrugBank |
| HMDB0004215 | HMDB |
| LMPK13090006 | LIPID MAPS |
| Piceatannol | Wikipedia |
| PIT | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1879860 | Reaxys |
| Beilstein:1879860 | Beilstein |
| CAS:10083-24-6 | ChemIDplus |
| CAS:10083-24-6 | KEGG COMPOUND |
| Citations |
|---|