EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H22O9 |
| Net Charge | 0 |
| Average Mass | 406.387 |
| Monoisotopic Mass | 406.12638 |
| SMILES | OC[C@H]1O[C@@H](Oc2cc(O)cc(/C=C/c3ccc(O)c(O)c3)c2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C20H22O9/c21-9-16-17(25)18(26)19(27)20(29-16)28-13-6-11(5-12(22)8-13)2-1-10-3-4-14(23)15(24)7-10/h1-8,16-27H,9H2/b2-1+/t16-,17-,18+,19-,20-/m1/s1 |
| InChIKey | PERPNFLGJXUDDW-CUYWLFDKSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trans-astringin (CHEBI:2899) has functional parent piceatannol (CHEBI:28814) |
| trans-astringin (CHEBI:2899) has role antineoplastic agent (CHEBI:35610) |
| trans-astringin (CHEBI:2899) has role antioxidant (CHEBI:22586) |
| trans-astringin (CHEBI:2899) has role metabolite (CHEBI:25212) |
| trans-astringin (CHEBI:2899) is a monosaccharide derivative (CHEBI:63367) |
| trans-astringin (CHEBI:2899) is a polyphenol (CHEBI:26195) |
| trans-astringin (CHEBI:2899) is a stilbenoid (CHEBI:26776) |
| trans-astringin (CHEBI:2899) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| 3-[(E)-2-(3,4-dihydroxyphenyl)ethenyl]-5-hydroxyphenyl β-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| Astringin | KEGG COMPOUND |
| (E)-Astringin | ChemIDplus |
| 3,4,3',5'-Tetrahydroxystilbene 3'-glucoside | ChemIDplus |
| piceatannol 3-β-D-glucoside | ChEBI |
| piceatannol 3-O-β-D-glucoside | ChEBI |
| piceatannol 3-β-glucoside | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C10245 | KEGG COMPOUND |
| Astringin | Wikipedia |
| LMPK13090007 | LIPID MAPS |
| C00002870 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1408080 | Reaxys |
| CAS:29884-49-9 | KEGG COMPOUND |
| CAS:29884-49-9 | ChemIDplus |
| Citations |
|---|