EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H14O4 |
| Net Charge | 0 |
| Average Mass | 258.273 |
| Monoisotopic Mass | 258.08921 |
| SMILES | COc1cc(/C=C/c2cc(O)cc(O)c2)ccc1O |
| InChI | InChI=1S/C15H14O4/c1-19-15-8-10(4-5-14(15)18)2-3-11-6-12(16)9-13(17)7-11/h2-9,16-18H,1H3/b3-2+ |
| InChIKey | ANNNBEZJTNCXHY-NSCUHMNNSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aïphanes aculeata (IPNI:316937-2) | seed (BTO:0001226) | PubMed (11440571) | |
| Homo sapiens (ncbitaxon:9606) | blood serum (BTO:0000133) | MetaboLights (MTBLS2542) |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. antiviral agent A substance that destroys or inhibits replication of viruses. |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. hypoglycemic agent A drug which lowers the blood glucose level. cardioprotective agent Any protective agent that is able to prevent damage to the heart. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isorhapontigenin (CHEBI:167830) has functional parent piceatannol (CHEBI:28814) |
| isorhapontigenin (CHEBI:167830) has role anti-inflammatory agent (CHEBI:67079) |
| isorhapontigenin (CHEBI:167830) has role antineoplastic agent (CHEBI:35610) |
| isorhapontigenin (CHEBI:167830) has role antioxidant (CHEBI:22586) |
| isorhapontigenin (CHEBI:167830) has role antiviral agent (CHEBI:22587) |
| isorhapontigenin (CHEBI:167830) has role cardioprotective agent (CHEBI:77307) |
| isorhapontigenin (CHEBI:167830) has role hypoglycemic agent (CHEBI:35526) |
| isorhapontigenin (CHEBI:167830) has role plant metabolite (CHEBI:76924) |
| isorhapontigenin (CHEBI:167830) is a guaiacols (CHEBI:134251) |
| isorhapontigenin (CHEBI:167830) is a polyphenol (CHEBI:26195) |
| isorhapontigenin (CHEBI:167830) is a resorcinols (CHEBI:33572) |
| isorhapontigenin (CHEBI:167830) is a stilbenol (CHEBI:36027) |
| IUPAC Name |
|---|
| 5-[(E)-2-(4-hydroxy-3-methoxyphenyl)ethenyl]benzene-1,3-diol |
| Synonyms | Source |
|---|---|
| 3'-methoxyresveratrol | ChEBI |
| 5-[(1E)-2-(4-hydroxy-3-methoxyphenyl)ethenyl]-1,3-benzenediol | ChEBI |
| (E)-isorhapontigenin | KNApSAcK |
| ISO | ChEBI |
| isorhapotigenin | KNApSAcK |
| isorhapotogenin | KNApSAcK |
| UniProt Name | Source |
|---|---|
| isorhapontigenin | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 4477172 | ChemSpider |
| C00015797 | KNApSAcK |
| CPD-27168 | MetaCyc |
| FDB008478 | FooDB |
| HMDB0303171 | HMDB |
| Isorhapontigenin | Wikipedia |
| Citations |
|---|