EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H42O2 |
| Net Charge | 0 |
| Average Mass | 338.576 |
| Monoisotopic Mass | 338.31848 |
| SMILES | CCCCCCCC/C=C\CCCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C22H42O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24/h9-10H,2-8,11-21H2,1H3,(H,23,24)/b10-9- |
| InChIKey | DPUOLQHDNGRHBS-KTKRTIGZSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| erucic acid (CHEBI:28792) is a docosenoic acid (CHEBI:36031) |
| erucic acid (CHEBI:28792) is conjugate acid of erucate (CHEBI:32393) |
| Incoming Relation(s) |
| N-[(13Z)-docosenoyl]-tetradecasphing-4-enine-1-phosphoethanolamine (CHEBI:86526) has functional parent erucic acid (CHEBI:28792) |
| N-[(13Z)-docosenoyl]sphing-4-enine-1-phosphocholine (CHEBI:74533) has functional parent erucic acid (CHEBI:28792) |
| 1-eicosanoyl-2-[(13Z)-docosenoyl]-sn-glycero-3-phosphocholine (CHEBI:86216) has functional parent erucic acid (CHEBI:28792) |
| 1-erucoylglycerol (CHEBI:142498) has functional parent erucic acid (CHEBI:28792) |
| 1-hexadecanoyl-2-(13Z-docosenoyl)-sn-glycero-3-phosphoethanolamine (CHEBI:73875) has functional parent erucic acid (CHEBI:28792) |
| 1-hexadecanoyl-2-[(13Z)-docosenoyl]-sn-glycero-3-phosphocholine (CHEBI:86174) has functional parent erucic acid (CHEBI:28792) |
| 1-octadecanoyl-2-[(13Z)-docosenoyl]-sn-glycero-3-phosphocholine (CHEBI:86196) has functional parent erucic acid (CHEBI:28792) |
| 2-hydroxyerucic acid (CHEBI:143027) has functional parent erucic acid (CHEBI:28792) |
| erucamide (CHEBI:142245) has functional parent erucic acid (CHEBI:28792) |
| erucoyl-CoA (CHEBI:74106) has functional parent erucic acid (CHEBI:28792) |
| ethyl (13Z)-docosenoate (CHEBI:84891) has functional parent erucic acid (CHEBI:28792) |
| α-Neu5Ac-(2→3)-β-D-Gal-(1→4)-β-D-Glc-(1↔1')-Cer(d18:1/22:1(13Z)) (CHEBI:84987) has functional parent erucic acid (CHEBI:28792) |
| erucate (CHEBI:32393) is conjugate base of erucic acid (CHEBI:28792) |
| erucoyl group (CHEBI:32394) is substituent group from erucic acid (CHEBI:28792) |
| IUPAC Name |
|---|
| (13Z)-docos-13-enoic acid |
| Synonyms | Source |
|---|---|
| 13-cis-docosenoic acid | ChemIDplus |
| (13Z)-13-docosenoic acid | NIST Chemistry WebBook |
| (13Z)-Docosenoic acid | KEGG COMPOUND |
| 22:1ω9 | ChEBI |
| C22:1n-9 | LIPID MAPS |
| cis-13-Docosenoic acid | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00001217 | KNApSAcK |
| C08316 | KEGG COMPOUND |
| CPD-14292 | MetaCyc |
| Erucic_acid | Wikipedia |
| HMDB0002068 | HMDB |
| LMFA01030089 | LIPID MAPS |
| Citations |
|---|