EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H42O3 |
| Net Charge | 0 |
| Average Mass | 354.575 |
| Monoisotopic Mass | 354.31340 |
| SMILES | CCCCCCCC/C=C\CCCCCCCCCCC(O)C(=O)O |
| InChI | InChI=1S/C22H42O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21(23)22(24)25/h9-10,21,23H,2-8,11-20H2,1H3,(H,24,25)/b10-9- |
| InChIKey | VZMAFALCHHMPNA-KTKRTIGZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Secale cereale (ncbitaxon:4550) | leaf (BTO:0000713) | PubMed (16667981) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-hydroxyerucic acid (CHEBI:143027) has functional parent erucic acid (CHEBI:28792) |
| 2-hydroxyerucic acid (CHEBI:143027) has role plant metabolite (CHEBI:76924) |
| 2-hydroxyerucic acid (CHEBI:143027) is a 2-hydroxy fatty acid (CHEBI:10283) |
| 2-hydroxyerucic acid (CHEBI:143027) is a hydroxy monounsaturated fatty acid (CHEBI:131869) |
| 2-hydroxyerucic acid (CHEBI:143027) is a long-chain fatty acid (CHEBI:15904) |
| 2-hydroxyerucic acid (CHEBI:143027) is conjugate acid of 2-hydroxyerucate (CHEBI:142988) |
| Incoming Relation(s) |
| 2-hydroxyerucate (CHEBI:142988) is conjugate base of 2-hydroxyerucic acid (CHEBI:143027) |
| IUPAC Name |
|---|
| (13Z)-2-hydroxydocos-13-enoic acid |
| Synonym | Source |
|---|---|
| (13Z)-2-hydroxy-13-docosenoic acid | ChEBI |
| Citations |
|---|