EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H41O2 |
| Net Charge | -1 |
| Average Mass | 337.568 |
| Monoisotopic Mass | 337.31120 |
| SMILES | CCCCCCCC/C=C\CCCCCCCCCCCC(=O)[O-] |
| InChI | InChI=1S/C22H42O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24/h9-10H,2-8,11-21H2,1H3,(H,23,24)/p-1/b10-9- |
| InChIKey | DPUOLQHDNGRHBS-KTKRTIGZSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| erucate (CHEBI:32393) is a docosenoate (CHEBI:78076) |
| erucate (CHEBI:32393) is a long-chain fatty acid anion (CHEBI:57560) |
| erucate (CHEBI:32393) is a unsaturated fatty acid anion (CHEBI:2580) |
| erucate (CHEBI:32393) is conjugate base of erucic acid (CHEBI:28792) |
| Incoming Relation(s) |
| (R,13Z)-docos-13-enoylcarnitine (CHEBI:235446) has functional parent erucate (CHEBI:32393) |
| N-(13Z-docosenoyl)-phytosphingosine (CHEBI:149662) has functional parent erucate (CHEBI:32393) |
| N-(13Z-docosenoyl)-sphinganine (CHEBI:149661) has functional parent erucate (CHEBI:32393) |
| 2-hydroxyerucate (CHEBI:142988) has functional parent erucate (CHEBI:32393) |
| erucic acid (CHEBI:28792) is conjugate acid of erucate (CHEBI:32393) |
| IUPAC Name |
|---|
| (13Z)-docos-13-enoate |
| Synonyms | Source |
|---|---|
| docos-13c-enoate | ChEBI |
| cis-Δ13-docosenoate | ChEBI |
| (Z)-13-docosenoate | ChEBI |
| (22:1n9) | ChEBI |
| UniProt Name | Source |
|---|---|
| (13Z)-docosenoate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-14292 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Gmelin:385960 | Gmelin |
| Reaxys:6116536 | Reaxys |