EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H48O4 |
| Net Charge | 0 |
| Average Mass | 412.655 |
| Monoisotopic Mass | 412.35526 |
| SMILES | CCCCCCCC/C=C\CCCCCCCCCCCC(=O)OCC(O)CO |
| InChI | InChI=1S/C25H48O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-25(28)29-23-24(27)22-26/h9-10,24,26-27H,2-8,11-23H2,1H3/b10-9- |
| InChIKey | ZXNAIPHYBVMMPY-KTKRTIGZSA-N |
| Roles Classification |
|---|
| Chemical Role: | food emulsifier A food additive used to form or maintain a uniform emulsion of two (or more) phases in a food. |
| Biological Role: | food emulsifier A food additive used to form or maintain a uniform emulsion of two (or more) phases in a food. |
| Application: | food emulsifier A food additive used to form or maintain a uniform emulsion of two (or more) phases in a food. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-erucoylglycerol (CHEBI:142498) has functional parent erucic acid (CHEBI:28792) |
| 1-erucoylglycerol (CHEBI:142498) has functional parent glycerol (CHEBI:17754) |
| 1-erucoylglycerol (CHEBI:142498) has role food emulsifier (CHEBI:63047) |
| 1-erucoylglycerol (CHEBI:142498) is a 1-monoglyceride (CHEBI:35759) |
| 1-erucoylglycerol (CHEBI:142498) is a fatty acid ester (CHEBI:35748) |
| IUPAC Name |
|---|
| 2,3-dihydroxypropyl (13Z)-docos-13-enoate |
| Synonyms | Source |
|---|---|
| 1-acylglycerol 22:1(13Z) | SUBMITTER |
| 1-monoerucin | ChEBI |
| monoerucin | ChEBI |
| UniProt Name | Source |
|---|---|
| 1-(13Z-docosenoyl)-glycerol | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1729493 | Reaxys |
| Citations |
|---|