EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H11NO3 |
| Net Charge | 0 |
| Average Mass | 181.191 |
| Monoisotopic Mass | 181.07389 |
| SMILES | [NH3+][C@H](Cc1ccc(O)cc1)C(=O)[O-] |
| InChI | InChI=1S/C9H11NO3/c10-8(9(12)13)5-6-1-3-7(11)4-2-6/h1-4,8,11H,5,10H2,(H,12,13)/t8-/m1/s1 |
| InChIKey | OUYCCCASQSFEME-MRVPVSSYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-tyrosine zwitterion (CHEBI:58570) is a D-α-amino acid zwitterion (CHEBI:59871) |
| D-tyrosine zwitterion (CHEBI:58570) is tautomer of D-tyrosine (CHEBI:28479) |
| Incoming Relation(s) |
| D-tyrosine (CHEBI:28479) is tautomer of D-tyrosine zwitterion (CHEBI:58570) |
| IUPAC Name |
|---|
| (2R)-2-ammonio-3-(4-hydroxyphenyl)propanoate |
| UniProt Name | Source |
|---|---|
| D-tyrosine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| D-TYROSINE | MetaCyc |