EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H10NO3 |
| Net Charge | -1 |
| Average Mass | 180.183 |
| Monoisotopic Mass | 180.06662 |
| SMILES | N[C@H](Cc1ccc(O)cc1)C(=O)[O-] |
| InChI | InChI=1S/C9H11NO3/c10-8(9(12)13)5-6-1-3-7(11)4-2-6/h1-4,8,11H,5,10H2,(H,12,13)/p-1/t8-/m1/s1 |
| InChIKey | OUYCCCASQSFEME-MRVPVSSYSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (15292242) |
| Roles Classification |
|---|
| Biological Role: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-tyrosinate(1−) (CHEBI:32773) has role Escherichia coli metabolite (CHEBI:76971) |
| D-tyrosinate(1−) (CHEBI:32773) is a tyrosinate(1−) (CHEBI:32784) |
| D-tyrosinate(1−) (CHEBI:32773) is conjugate acid of D-tyrosinate(2−) (CHEBI:32774) |
| D-tyrosinate(1−) (CHEBI:32773) is conjugate base of D-tyrosine (CHEBI:28479) |
| D-tyrosinate(1−) (CHEBI:32773) is enantiomer of L-tyrosinate(1−) (CHEBI:32760) |
| Incoming Relation(s) |
| D-tyrosine (CHEBI:28479) is conjugate acid of D-tyrosinate(1−) (CHEBI:32773) |
| D-tyrosinate(2−) (CHEBI:32774) is conjugate base of D-tyrosinate(1−) (CHEBI:32773) |
| L-tyrosinate(1−) (CHEBI:32760) is enantiomer of D-tyrosinate(1−) (CHEBI:32773) |
| IUPAC Name |
|---|
| hydrogen D-tyrosinate |
| Synonyms | Source |
|---|---|
| (2R)-2-amino-3-(4-hydroxyphenyl)propanoate | IUPAC |
| D-tyrosinate(1−) | JCBN |
| D-tyrosine monoanion | JCBN |
| Registry Numbers | Sources |
|---|---|
| Gmelin:1484464 | Gmelin |