EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24O2 |
| Net Charge | 0 |
| Average Mass | 236.355 |
| Monoisotopic Mass | 236.17763 |
| SMILES | C=C(C)[C@@H]1CC=C2[C@H](O)C[C@@H](O)[C@@H](C)[C@@]2(C)C1 |
| InChI | InChI=1S/C15H24O2/c1-9(2)11-5-6-12-14(17)7-13(16)10(3)15(12,4)8-11/h6,10-11,13-14,16-17H,1,5,7-8H2,2-4H3/t10-,11-,13-,14-,15-/m1/s1 |
| InChIKey | BXXSHQYDJWZXPB-OKNSCYNVSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Capsicum annuum (ncbitaxon:4072) | Root (BTO:0001188) | PubMed (24178358) | |
| Nicotiana benthamiana (ncbitaxon:4100) | leaf (BTO:0000713) | PubMed (34395763) | |
| Nicotiana silvestris (IPNI:817067-1) | - | PubMed (8316587) |
| Roles Classification |
|---|
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. phytoalexin A toxin made by a plant that acts against an organism attacking it. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| capsidiol (CHEBI:28283) has functional parent (+)-5-epi-aristolochene (CHEBI:23925) |
| capsidiol (CHEBI:28283) has role antifungal agent (CHEBI:35718) |
| capsidiol (CHEBI:28283) has role plant metabolite (CHEBI:76924) |
| capsidiol (CHEBI:28283) is a eremophilane sesquiterpenoid (CHEBI:36753) |
| capsidiol (CHEBI:28283) is a octahydronaphthalenes (CHEBI:138397) |
| capsidiol (CHEBI:28283) is a sesquiterpene phytoalexin (CHEBI:142279) |
| Incoming Relation(s) |
| capsidiol 3-acetate (CHEBI:183320) has functional parent capsidiol (CHEBI:28283) |
| IUPAC Names |
|---|
| (1R,3R,4S,4aR,6R)-4,4a-dimethyl-6-(prop-1-en-2-yl)-1,2,3,4,4a,5,6,7-octahydronaphthalene-1,3-diol |
| 1β,3α,4βH-eremophila-9,11-diene-1,3-diol |
| Synonyms | Source |
|---|---|
| (1R,3R,4S,4aR,6R)-6-isopropenyl-4,4a-dimethyl-1,2,3,4,4a,5,6,7-octahydronaphthalene-1,3-diol | IUPAC |
| Capsidiol | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| capsidiol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00003108 | KNApSAcK |
| C09627 | KEGG COMPOUND |
| C09627 | KEGG COMPOUND |
| Capsidiol | Wikipedia |
| CPD-4661 | MetaCyc |
| FDB014812 | FooDB |
| HMDB0002352 | HMDB |
| LMPR0103250002 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Beilstein:2331764 | Beilstein |
| CAS:37208-05-2 | KEGG COMPOUND |
| CAS:37208-05-2 | ChemIDplus |
| Citations |
|---|