EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24O2 |
| Net Charge | 0 |
| Average Mass | 236.355 |
| Monoisotopic Mass | 236.17763 |
| SMILES | C=C(C)[C@@H]1CC=C2[C@H](O)C[C@@H](O)[C@@H](C)[C@@]2(C)C1 |
| InChI | InChI=1S/C15H24O2/c1-9(2)11-5-6-12-14(17)7-13(16)10(3)15(12,4)8-11/h6,10-11,13-14,16-17H,1,5,7-8H2,2-4H3/t10-,11-,13-,14-,15-/m1/s1 |
| InChIKey | BXXSHQYDJWZXPB-OKNSCYNVSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Capsicum annuum (ncbitaxon:4072) | Root (BTO:0001188) | PubMed (24178358) | |
| Nicotiana benthamiana (ncbitaxon:4100) | leaf (BTO:0000713) | PubMed (34395763) | |
| Nicotiana silvestris (IPNI:817067-1) | - | PubMed (8316587) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. phytoalexin A toxin made by a plant that acts against an organism attacking it. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| capsidiol (CHEBI:28283) has functional parent (+)-5-epi-aristolochene (CHEBI:23925) |
| capsidiol (CHEBI:28283) has role antifungal agent (CHEBI:35718) |
| capsidiol (CHEBI:28283) has role plant metabolite (CHEBI:76924) |
| capsidiol (CHEBI:28283) is a eremophilane sesquiterpenoid (CHEBI:36753) |
| capsidiol (CHEBI:28283) is a octahydronaphthalenes (CHEBI:138397) |
| capsidiol (CHEBI:28283) is a sesquiterpene phytoalexin (CHEBI:142279) |
| Incoming Relation(s) |
| capsidiol 3-acetate (CHEBI:183320) has functional parent capsidiol (CHEBI:28283) |
| IUPAC Names |
|---|
| (1R,3R,4S,4aR,6R)-4,4a-dimethyl-6-(prop-1-en-2-yl)-1,2,3,4,4a,5,6,7-octahydronaphthalene-1,3-diol |
| 1β,3α,4βH-eremophila-9,11-diene-1,3-diol |
| Synonyms | Source |
|---|---|
| (1R,3R,4S,4aR,6R)-6-isopropenyl-4,4a-dimethyl-1,2,3,4,4a,5,6,7-octahydronaphthalene-1,3-diol | IUPAC |
| Capsidiol | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| capsidiol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00003108 | KNApSAcK |
| C09627 | KEGG COMPOUND |
| C09627 | KEGG COMPOUND |
| Capsidiol | Wikipedia |
| CPD-4661 | MetaCyc |
| FDB014812 | FooDB |
| HMDB0002352 | HMDB |
| LMPR0103250002 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Beilstein:2331764 | Beilstein |
| CAS:37208-05-2 | KEGG COMPOUND |
| CAS:37208-05-2 | ChemIDplus |
| Citations |
|---|