EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24 |
| Net Charge | 0 |
| Average Mass | 204.357 |
| Monoisotopic Mass | 204.18780 |
| SMILES | C=C(C)[C@@H]1CC=C2CCC[C@@H](C)[C@@]2(C)C1 |
| InChI | InChI=1S/C15H24/c1-11(2)13-8-9-14-7-5-6-12(3)15(14,4)10-13/h9,12-13H,1,5-8,10H2,2-4H3/t12-,13-,15-/m1/s1 |
| InChIKey | YONHOSLUBQJXPR-UMVBOHGHSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-5-epi-aristolochene (CHEBI:23925) has role plant metabolite (CHEBI:76924) |
| (+)-5-epi-aristolochene (CHEBI:23925) is a carbobicyclic compound (CHEBI:36785) |
| (+)-5-epi-aristolochene (CHEBI:23925) is a octahydronaphthalenes (CHEBI:138397) |
| (+)-5-epi-aristolochene (CHEBI:23925) is a sesquiterpene (CHEBI:35189) |
| Incoming Relation(s) |
| 1-deoxycapsidiol (CHEBI:72638) has functional parent (+)-5-epi-aristolochene (CHEBI:23925) |
| 2β-hydroxy-5-epi-aristolochene (CHEBI:142082) has functional parent (+)-5-epi-aristolochene (CHEBI:23925) |
| 3-deoxycapsidiol (CHEBI:72642) has functional parent (+)-5-epi-aristolochene (CHEBI:23925) |
| capsidiol (CHEBI:28283) has functional parent (+)-5-epi-aristolochene (CHEBI:23925) |
| IUPAC Names |
|---|
| (4R,4aR,6R)-4,4a-dimethyl-6-(prop-1-en-2-yl)-1,2,3,4,4a,5,6,7-octahydronaphthalene |
| 4βH-eremophila-9,11-diene |
| Synonym | Source |
|---|---|
| epi-aristolochene | ChEBI |
| UniProt Name | Source |
|---|---|
| (+)-5-epi-aristolochene | UniProt |
| Registry Numbers | Sources |
|---|---|
| Beilstein:3588800 | Beilstein |
| Reaxys:6500129 | Reaxys |
| Citations |
|---|