EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H26O3 |
| Net Charge | 0 |
| Average Mass | 278.392 |
| Monoisotopic Mass | 278.18819 |
| SMILES | C=C(C)[C@@H]1CC=C2[C@H](O)C[C@@H](OC(C)=O)[C@@H](C)[C@@]2(C)C1 |
| InChI | InChI=1S/C17H26O3/c1-10(2)13-6-7-14-15(19)8-16(20-12(4)18)11(3)17(14,5)9-13/h7,11,13,15-16,19H,1,6,8-9H2,2-5H3/t11-,13-,15-,16-,17-/m1/s1 |
| InChIKey | SLKXYDPIYYJVRG-MNGYRCLDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Hydrocotyle ramiflora (ncbitaxon:1138480) | - | PubMed (17253267) | |
| Nicotiana benthamiana (ncbitaxon:4100) | - | PubMed (25993114) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. phytoalexin A toxin made by a plant that acts against an organism attacking it. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| capsidiol 3-acetate (CHEBI:183320) has functional parent capsidiol (CHEBI:28283) |
| capsidiol 3-acetate (CHEBI:183320) has role plant metabolite (CHEBI:76924) |
| capsidiol 3-acetate (CHEBI:183320) is a acetate ester (CHEBI:47622) |
| capsidiol 3-acetate (CHEBI:183320) is a eremophilane sesquiterpenoid (CHEBI:36753) |
| capsidiol 3-acetate (CHEBI:183320) is a octahydronaphthalenes (CHEBI:138397) |
| capsidiol 3-acetate (CHEBI:183320) is a sesquiterpene phytoalexin (CHEBI:142279) |
| IUPAC Name |
|---|
| (1S,2R,4R,7R,8aR)-4-hydroxy-1,8a-dimethyl-7-(prop-1-en-2-yl)-1,2,3,4,6,7,8,8a-octahydronaphthalen-2-yl acetate |
| Manual Xrefs | Databases |
|---|---|
| CPD-20621 | MetaCyc |
| Citations |
|---|