EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H13NO3 |
| Net Charge | 0 |
| Average Mass | 207.229 |
| Monoisotopic Mass | 207.08954 |
| SMILES | CC(=O)N[C@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C11H13NO3/c1-8(13)12-10(11(14)15)7-9-5-3-2-4-6-9/h2-6,10H,7H2,1H3,(H,12,13)(H,14,15)/t10-/m1/s1 |
| InChIKey | CBQJSKKFNMDLON-SNVBAGLBSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-acetyl-D-phenylalanine (CHEBI:28203) is a N-acetyl-D-amino acid (CHEBI:21501) |
| N-acetyl-D-phenylalanine (CHEBI:28203) is a N-acetylphenylalanine (CHEBI:21626) |
| N-acetyl-D-phenylalanine (CHEBI:28203) is a N-acyl-D-phenylalanine (CHEBI:77672) |
| N-acetyl-D-phenylalanine (CHEBI:28203) is conjugate acid of N-acetyl-D-phenylalaninate (CHEBI:143878) |
| N-acetyl-D-phenylalanine (CHEBI:28203) is enantiomer of N-acetyl-L-phenylalanine (CHEBI:16259) |
| Incoming Relation(s) |
| N-acetyl-D-phenylalaninate (CHEBI:143878) is conjugate base of N-acetyl-D-phenylalanine (CHEBI:28203) |
| N-acetyl-L-phenylalanine (CHEBI:16259) is enantiomer of N-acetyl-D-phenylalanine (CHEBI:28203) |
| IUPAC Name |
|---|
| N-acetyl-D-phenylalanine |
| Synonym | Source |
|---|---|
| N-Acetyl-D-phenylalanine | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C05620 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Beilstein:2213852 | Beilstein |
| CAS:10172-89-1 | KEGG COMPOUND |