EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H13NO3 |
| Net Charge | 0 |
| Average Mass | 207.229 |
| Monoisotopic Mass | 207.08954 |
| SMILES | CC(=O)NC(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C11H13NO3/c1-8(13)12-10(11(14)15)7-9-5-3-2-4-6-9/h2-6,10H,7H2,1H3,(H,12,13)(H,14,15) |
| InChIKey | CBQJSKKFNMDLON-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-acetylphenylalanine (CHEBI:21626) has role antidepressant (CHEBI:35469) |
| N-acetylphenylalanine (CHEBI:21626) has role metabolite (CHEBI:25212) |
| N-acetylphenylalanine (CHEBI:21626) is a N-acetyl-amino acid (CHEBI:21575) |
| N-acetylphenylalanine (CHEBI:21626) is a phenylalanine derivative (CHEBI:25985) |
| Incoming Relation(s) |
| N-acetyl-D-phenylalanine (CHEBI:28203) is a N-acetylphenylalanine (CHEBI:21626) |
| N-acetyl-L-phenylalanine (CHEBI:16259) is a N-acetylphenylalanine (CHEBI:21626) |
| IUPAC Names |
|---|
| 2-(acetylamino)-3-phenylpropanoic acid |
| N-acetylphenylalanine |
| INNs | Source |
|---|---|
| afalanina | ChemIDplus |
| afalanine | ChemIDplus |
| afalaninum | ChemIDplus |
| Synonym | Source |
|---|---|
| N-Acetyl-3-phenyl-DL-alanine | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2213851 | Reaxys |
| CAS:2901-75-9 | ChemIDplus |